The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-O-acetylrocaglaol ID: ALA476922
PubChem CID: 11363545
Max Phase: Preclinical
Molecular Formula: C28H28O7
Molecular Weight: 476.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 1-O-Acetylrocaglaol | 1-O-acetylrocaglaol|CHEMBL476922
Canonical SMILES: COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4[C@]2(O)[C@H](OC(C)=O)C[C@H]3c2ccccc2)cc1
Standard InChI: InChI=1S/C28H28O7/c1-17(29)34-25-16-22(18-8-6-5-7-9-18)28(19-10-12-20(31-2)13-11-19)27(25,30)26-23(33-4)14-21(32-3)15-24(26)35-28/h5-15,22,25,30H,16H2,1-4H3/t22-,25+,27+,28-/m0/s1
Standard InChI Key: CGFKKPRGWNMNFP-CEYYOHNYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-2.2201 1.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2213 0.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5058 -0.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5076 1.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7916 1.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7913 0.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0045 -0.0363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0049 1.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4772 0.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2629 0.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2663 1.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4827 1.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2307 2.7538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9257 0.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8347 -0.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4999 -0.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2565 -0.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3441 0.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6779 0.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6881 -0.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1021 -0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3124 -1.5364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1073 -1.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6918 -1.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4784 -0.3744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3200 -2.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7354 -3.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4254 2.0226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5101 2.2816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9368 -0.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6515 0.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2264 2.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7858 3.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5338 4.1560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5927 3.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
8 9 1 0
17 18 1 0
1 2 2 0
18 19 2 0
19 14 1 0
10 14 1 1
5 4 2 0
9 20 1 1
4 1 1 0
20 21 2 0
5 6 1 0
21 22 1 0
22 23 2 0
9 10 1 0
23 24 1 0
10 11 1 0
24 25 2 0
25 20 1 0
11 12 1 0
23 26 1 0
12 8 1 0
26 27 1 0
2 3 1 0
8 28 1 1
12 13 1 6
4 29 1 0
3 6 2 0
2 30 1 0
6 7 1 0
30 31 1 0
14 15 2 0
29 32 1 0
7 9 1 0
13 33 1 0
15 16 1 0
33 34 2 0
8 5 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.53Molecular Weight (Monoisotopic): 476.1835AlogP: 4.31#Rotatable Bonds: 6Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.63CX Basic pKa: ┄CX LogP: 3.81CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: 1.57
References 1. Rivero-Cruz JF, Chai HB, Kardono LB, Setyowati FM, Afriatini JJ, Riswan S, Farnsworth NR, Cordell GA, Pezzuto JM, Swanson SM, Kinghorn AD.. (2004) Cytotoxic constituents of the twigs and leaves of Aglaia rubiginosa., 67 (3): [PMID:15043407 ] [10.1021/np0304417 ]