The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(cyanomethyl)-3-(3,5-dimethylphenyl)-2-(2,2-diphenylacetamido)propanamide ID: ALA477531
PubChem CID: 11761693
Max Phase: Preclinical
Molecular Formula: C27H27N3O2
Molecular Weight: 425.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)cc(CC(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCC#N)c1
Standard InChI: InChI=1S/C27H27N3O2/c1-19-15-20(2)17-21(16-19)18-24(26(31)29-14-13-28)30-27(32)25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-12,15-17,24-25H,14,18H2,1-2H3,(H,29,31)(H,30,32)
Standard InChI Key: UHSPVUASELRRIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-4.8431 0.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8443 0.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1294 -0.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4130 0.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4159 0.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1312 1.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6979 -0.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6966 -1.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4117 -1.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4108 -2.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6951 -2.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9789 -2.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9834 -1.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9841 0.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2689 -0.3318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9854 0.9046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5551 0.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1600 -0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5564 0.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1574 1.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8722 0.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5855 1.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5847 2.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8645 2.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1541 2.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3004 0.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8603 3.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1613 -1.1546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8738 0.0840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5889 -0.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3028 0.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0125 0.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
14 16 2 0
7 8 1 0
15 17 1 0
17 18 1 0
8 9 2 0
17 19 1 0
4 5 1 0
19 20 1 0
9 10 1 0
20 21 2 0
2 3 1 0
21 22 1 0
10 11 2 0
22 23 2 0
5 6 2 0
23 24 1 0
11 12 1 0
24 25 2 0
25 20 1 0
6 1 1 0
22 26 1 0
12 13 2 0
24 27 1 0
13 8 1 0
18 28 2 0
1 2 2 0
18 29 1 0
7 14 1 0
29 30 1 0
4 7 1 0
30 31 1 0
14 15 1 0
31 32 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.53Molecular Weight (Monoisotopic): 425.2103AlogP: 3.80#Rotatable Bonds: 8Polar Surface Area: 81.99Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.10CX Basic pKa: ┄CX LogP: 4.39CX LogD: 4.39Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.60
References 1. Méthot N, Rubin J, Guay D, Beaulieu C, Ethier D, Reddy TJ, Riendeau D, Percival MD.. (2007) Inhibition of the activation of multiple serine proteases with a cathepsin C inhibitor requires sustained exposure to prevent pro-enzyme processing., 282 (29): [PMID:17535802 ] [10.1074/jbc.m702615200 ]