(2R)-2-[(6-Acetyl-(5Sa)-5-(3-chloro-2-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl)thieno[2,3-d]pyrimidin-4-yl)oxy]-3-phenylpropanoic acid

ID: ALA4776023

PubChem CID: 162643800

Max Phase: Preclinical

Molecular Formula: C31H33ClN4O5S

Molecular Weight: 609.15

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1sc2ncnc(O[C@H](Cc3ccccc3)C(=O)O)c2c1-c1ccc(OCCN2CCN(C)CC2)c(Cl)c1C

Standard InChI:  InChI=1S/C31H33ClN4O5S/c1-19-22(9-10-23(27(19)32)40-16-15-36-13-11-35(3)12-14-36)25-26-29(33-18-34-30(26)42-28(25)20(2)37)41-24(31(38)39)17-21-7-5-4-6-8-21/h4-10,18,24H,11-17H2,1-3H3,(H,38,39)/t24-/m1/s1

Standard InChI Key:  FDUXEUYHPUGQRD-XMMPIXPASA-N

Molfile:  

 
     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
   25.2242   -2.1379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2231   -2.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9311   -3.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6408   -2.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6379   -2.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9293   -1.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3491   -3.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3504   -4.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0587   -4.5891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6433   -4.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9350   -4.1838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6446   -5.4085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0600   -5.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3544   -5.8131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3553   -6.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0642   -7.0379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7692   -5.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7776   -6.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5525   -6.8637    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.0231   -6.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5389   -5.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7809   -4.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5798   -4.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8244   -3.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2710   -3.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4699   -3.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2291   -4.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1322   -5.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6220   -3.6396    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   30.5145   -2.4347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3118   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8656   -2.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6629   -2.6772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2170   -3.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0112   -3.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2588   -2.3255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7057   -1.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9051   -1.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0568   -2.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8402   -6.1933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2561   -6.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2414   -5.4814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  8  7  1  1
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 18  1  0
 17 13  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 22 27  1  0
 21 22  1  0
 23 28  1  0
 24 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 36 39  1  0
 20 40  1  0
 40 41  1  0
 40 42  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4776023

    ---

Associated Targets(Human)

NCI-H929 (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 609.15Molecular Weight (Monoisotopic): 608.1860AlogP: 5.22#Rotatable Bonds: 11
Polar Surface Area: 105.09Molecular Species: ACIDHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.08CX Basic pKa: 7.65CX LogP: 2.88CX LogD: 2.74
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.23Np Likeness Score: -0.78

References

1. Szlavik Z,Csekei M,Paczal A,Szabo ZB,Sipos S,Radics G,Proszenyak A,Balint B,Murray J,Davidson J,Chen I,Dokurno P,Surgenor AE,Daniels ZM,Hubbard RE,Le Toumelin-Braizat G,Claperon A,Lysiak-Auvity G,Girard AM,Bruno A,Chanrion M,Colland F,Maragno AL,Demarles D,Geneste O,Kotschy A.  (2020)  Discovery of S64315, a Potent and Selective Mcl-1 Inhibitor.,  63  (22): [PMID:33146521] [10.1021/acs.jmedchem.0c01234]

Source