Artemyrianolide S

ID: ALA4776030

PubChem CID: 162643848

Max Phase: Preclinical

Molecular Formula: C15H20O5

Molecular Weight: 280.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2C[C@@]3(C)[C@H](O)CCC(=C)[C@]3(OO)C[C@H]12

Standard InChI:  InChI=1S/C15H20O5/c1-8-4-5-12(16)14(3)7-11-10(6-15(8,14)20-18)9(2)13(17)19-11/h10-12,16,18H,1-2,4-7H2,3H3/t10-,11+,12-,14+,15-/m1/s1

Standard InChI Key:  BQOHWXIYPOOARZ-FMKNKJFCSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   39.3160  -20.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3160  -21.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0213  -21.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0213  -20.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7265  -20.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7231  -21.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4251  -21.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4321  -20.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1386  -20.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1372  -21.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9136  -21.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3950  -21.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9159  -20.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2121  -21.1244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1647  -22.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0213  -19.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.7192  -19.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0221  -22.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7151  -22.3366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1307  -22.3448    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.1307  -19.8932    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.4188  -22.7521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 12 14  2  0
 11 15  2  0
  4 16  1  1
  5 17  1  1
  3 18  2  0
  6 19  1  6
 10 20  1  6
  9 21  1  1
 19 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776030

    ---

Associated Targets(Human)

SMMC-7721 (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 280.32Molecular Weight (Monoisotopic): 280.1311AlogP: 1.82#Rotatable Bonds: 1
Polar Surface Area: 75.99Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.69CX Basic pKa: CX LogP: 1.57CX LogD: 1.57
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.25Np Likeness Score: 3.38

References

1. Tang S,Zhang XT,Ma YB,Huang XY,Geng CA,Li TZ,Zhang XM,Shen C,Su LH,Gao Z,Chen JJ.  (2020)  Artemyrianolides A-S, Cytotoxic Sesquiterpenoids from Artemisia myriantha.,  83  (9.0): [PMID:32842729] [10.1021/acs.jnatprod.0c00396]

Source