N-hydroxy-N-(2-(5-((4-(morpholinomethyl)phenyl)ethynyl)-1H-indol-1-yl)ethyl)formamide

ID: ALA4776055

PubChem CID: 162642899

Max Phase: Preclinical

Molecular Formula: C24H25N3O3

Molecular Weight: 403.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=CN(O)CCn1ccc2cc(C#Cc3ccc(CN4CCOCC4)cc3)ccc21

Standard InChI:  InChI=1S/C24H25N3O3/c28-19-27(29)12-11-26-10-9-23-17-21(7-8-24(23)26)4-1-20-2-5-22(6-3-20)18-25-13-15-30-16-14-25/h2-3,5-10,17,19,29H,11-16,18H2

Standard InChI Key:  SKWQBORLRAILHB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.8145  -17.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8133  -18.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5281  -19.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5263  -17.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0986  -19.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3786  -19.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6602  -20.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9528  -19.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2349  -20.0224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2265  -20.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9420  -21.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6569  -20.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5088  -21.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7978  -20.8364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8045  -20.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0977  -19.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3774  -19.9962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3686  -20.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0800  -21.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2416  -17.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2465  -18.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0338  -19.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5157  -18.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0261  -17.7264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2763  -16.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0823  -16.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3325  -15.9781    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1384  -15.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3887  -15.0158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7770  -15.3683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 21  2  0
 20  4  2  0
  4  1  1  0
  2  5  1  0
  5  6  3  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776055

    ---

Associated Targets(non-human)

lpxC UDP-3-O-acyl-GlcNAc deacetylase (700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 403.48Molecular Weight (Monoisotopic): 403.1896AlogP: 2.72#Rotatable Bonds: 6
Polar Surface Area: 57.94Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.35CX Basic pKa: 6.76CX LogP: 2.92CX LogD: 2.97
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -1.17

References

1. Furuya T,Shapiro AB,Comita-Prevoir J,Kuenstner EJ,Zhang J,Ribe SD,Chen A,Hines D,Moussa SH,Carter NM,Sylvester MA,Romero JAC,Vega CV,Sacco MD,Chen Y,O'Donnell JP,Durand-Reville TF,Miller AA,Tommasi RA.  (2020)  N-Hydroxyformamide LpxC inhibitors, their in vivo efficacy in a mouse Escherichia coli infection model, and their safety in a rat hemodynamic assay.,  28  (24): [PMID:33160146] [10.1016/j.bmc.2020.115826]

Source