5-[2-(4-aminobutylcarbamoyl)phenyl]-N-(3-pyrrolidin-1-ylpropyl)pyridine-3-carboxamide

ID: ALA4776089

PubChem CID: 162643107

Max Phase: Preclinical

Molecular Formula: C24H33N5O2

Molecular Weight: 423.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCCNC(=O)c1ccccc1-c1cncc(C(=O)NCCCN2CCCC2)c1

Standard InChI:  InChI=1S/C24H33N5O2/c25-10-3-4-11-28-24(31)22-9-2-1-8-21(22)19-16-20(18-26-17-19)23(30)27-12-7-15-29-13-5-6-14-29/h1-2,8-9,16-18H,3-7,10-15,25H2,(H,27,30)(H,28,31)

Standard InChI Key:  BGNFVKLHIDCADM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.5905  -22.9639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5893  -23.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2974  -24.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0112  -23.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0083  -22.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2956  -22.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7186  -22.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4320  -22.9549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7156  -21.7236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1423  -22.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8557  -22.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5660  -22.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2793  -22.9443    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3644  -23.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1685  -23.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5744  -23.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0211  -22.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965  -25.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5865  -25.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5850  -26.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2926  -26.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0033  -26.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0014  -25.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7086  -25.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4168  -25.4139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7075  -24.1890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1240  -25.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8322  -25.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5394  -25.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2476  -25.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9548  -25.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  3 18  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776089

    ---

Associated Targets(Human)

SMYD2 Tchem N-lysine methyltransferase SMYD2 (395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.56Molecular Weight (Monoisotopic): 423.2634AlogP: 2.43#Rotatable Bonds: 11
Polar Surface Area: 100.35Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: 10.00CX LogP: 0.82CX LogD: -3.45
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.14

References

1. Zhang B,Liao L,Wu F,Zhang F,Sun Z,Chen H,Luo C.  (2020)  Synthesis and structure-activity relationship studies of LLY-507 analogues as SMYD2 inhibitors.,  30  (22): [PMID:33011288] [10.1016/j.bmcl.2020.127598]

Source