(4aR,6R,6aR,9S,11S,11bS,12R,14R)-11b-(acetoxymethyl)-6,11-dihydroxy-4,4-dimethyl-8-methylene-7-oxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl-3-phenylpropanoate

ID: ALA4776117

PubChem CID: 162643232

Max Phase: Preclinical

Molecular Formula: C31H40O7

Molecular Weight: 524.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)CCc1ccccc1

Standard InChI:  InChI=1S/C31H40O7/c1-18-21-15-22(33)26-30(17-37-19(2)32)14-8-13-29(3,4)23(30)16-24(34)31(26,27(18)36)28(21)38-25(35)12-11-20-9-6-5-7-10-20/h5-7,9-10,21-24,26,28,33-34H,1,8,11-17H2,2-4H3/t21-,22+,23-,24-,26+,28-,30+,31-/m1/s1

Standard InChI Key:  JXDJGTOCYYYYDR-WHYXOBIFSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   39.5430   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1385   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7295   -5.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -3.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2723   -3.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5583   -2.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9863   -2.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1385   -2.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9863   -2.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5583   -4.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5583   -2.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2723   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4245   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2723   -1.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4245   -3.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -2.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5583   -3.6939    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -4.9279    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.4816   -2.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0647   -3.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1683   -1.2422    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.1407   -2.0471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1407   -1.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4330   -0.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8484   -0.8213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8514   -1.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.4559   -4.0564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6941   -3.2768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.9810   -4.5093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.0965   -3.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6858   -4.6851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9137   -3.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2926   -2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3202   -4.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1374   -4.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5383   -5.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3548   -5.4040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7663   -4.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3554   -3.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5403   -3.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  7  1  0
  6  4  1  0
  7  4  1  0
  2  6  1  0
  8  5  1  0
  9  4  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13  5  1  0
 14 16  1  0
 15 12  1  0
 16  9  1  0
  4 17  1  6
  7 18  1  1
  6 19  1  1
 14  2  1  0
 13 11  1  0
 10  8  1  0
 10 20  1  0
  5 21  1  1
 21 20  1  0
 10 22  1  1
 17 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 12 27  1  1
 21 28  2  0
  8 29  1  1
 13 30  1  6
 29 31  1  0
 31 32  2  0
 31 33  1  0
 20 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776117

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TE-1 (337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.65Molecular Weight (Monoisotopic): 524.2774AlogP: 3.79#Rotatable Bonds: 6
Polar Surface Area: 110.13Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.43Np Likeness Score: 2.54

References

1. Huo JF,Hu TX,Dong YL,Zhao JZ,Liu XJ,Li LL,Zhang XY,Li YF,Liu HM,Ke Y,Wang C.  (2020)  Synthesis and in vitro and in vivo biological evaluation of novel derivatives of flexicaulin A as antiproliferative agents.,  208  [PMID:32883640] [10.1016/j.ejmech.2020.112789]

Source