The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(3,5-Dibromophenyl)-4-oxo-4-((R)-3-(2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl)pyrrolidin-1-yl)butanoic acid ID: ALA4776138
PubChem CID: 162643332
Max Phase: Preclinical
Molecular Formula: C24H27Br2N3O3
Molecular Weight: 565.31
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C[C@H](C(=O)N1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)c1cc(Br)cc(Br)c1
Standard InChI: InChI=1S/C24H27Br2N3O3/c25-18-10-17(11-19(26)12-18)21(13-22(30)31)24(32)29-9-7-15(14-29)3-5-20-6-4-16-2-1-8-27-23(16)28-20/h4,6,10-12,15,21H,1-3,5,7-9,13-14H2,(H,27,28)(H,30,31)/t15-,21+/m1/s1
Standard InChI Key: NSLLXYFCBUUZFG-VFNWGFHPSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.6788 -23.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6788 -24.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3841 -24.7799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3841 -23.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0894 -23.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0859 -24.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7880 -24.7847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4980 -24.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5015 -23.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7949 -23.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2034 -24.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9134 -24.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6188 -24.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6963 -25.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4946 -25.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9072 -25.0802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3638 -24.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7204 -24.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1971 -25.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0569 -24.2546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8606 -26.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0103 -25.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0477 -26.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7112 -27.2293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1880 -27.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0051 -27.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3379 -27.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4869 -26.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3001 -26.1650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1504 -26.9906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4833 -28.4690 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
17.8976 -27.3052 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
8 11 1 0
11 12 1 0
13 12 1 1
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 1 1
19 22 1 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
22 28 1 0
28 29 1 0
28 30 2 0
26 31 1 0
24 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.31Molecular Weight (Monoisotopic): 563.0419AlogP: 5.00#Rotatable Bonds: 7Polar Surface Area: 82.53Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.13CX Basic pKa: 7.52CX LogP: 2.28CX LogD: 2.04Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.32
References 1. Lippa RA,Barrett J,Pal S,Rowedder JE,Murphy JA,Barrett TN. (2020) Discovery of the first potent and selective αβ integrin inhibitor based on an amide-containing core., 208 [PMID:32865176 ] [10.1016/j.ejmech.2020.112719 ]