1-(2-chloro-4-((2-morpholinoethyl)amino)phenyl)-5-(trifluoromethyl)pyridin-2(1H)-one

ID: ALA4776146

PubChem CID: 49820718

Max Phase: Preclinical

Molecular Formula: C18H19ClF3N3O2

Molecular Weight: 401.82

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1ccc(C(F)(F)F)cn1-c1ccc(NCCN2CCOCC2)cc1Cl

Standard InChI:  InChI=1S/C18H19ClF3N3O2/c19-15-11-14(23-5-6-24-7-9-27-10-8-24)2-3-16(15)25-12-13(18(20,21)22)1-4-17(25)26/h1-4,11-12,23H,5-10H2

Standard InChI Key:  ZHNYJLYSBGBBJP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   39.6427   -4.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6425   -3.3886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9347   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3501   -2.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9345   -2.1630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3499   -2.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6421   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0579   -3.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2267   -1.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2265   -0.9374    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.5191   -2.1633    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.5165   -1.3455    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.9326   -4.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9324   -5.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6408   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3507   -5.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3474   -4.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2257   -4.2020    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.6420   -6.6549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3504   -7.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0574   -6.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7658   -7.0602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.4729   -6.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7671   -7.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1812   -7.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1825   -7.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.4754   -8.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  3  5  2  0
  4  6  1  0
  5  7  1  0
  6  7  2  0
  4  8  2  0
  5  9  1  0
  9 10  1  0
  9 11  1  0
  9 12  1  0
  1 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  1  1  0
 13 18  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  1  0
 24 27  1  0
 25 26  1  0
 26 27  1  0
M  END

Associated Targets(non-human)

NIH3T3 (5395 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.82Molecular Weight (Monoisotopic): 401.1118AlogP: 3.25#Rotatable Bonds: 5
Polar Surface Area: 46.50Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.69CX LogP: 2.38CX LogD: 2.31
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.84Np Likeness Score: -1.95

References

1. Chen J,Peng Z,Lu M,Xiong X,Chen Z,Li Q,Cheng Z,Jiang D,Tao L,Hu G.  (2018)  Discovery of 1-(4-((3-(4-methylpiperazin-1-yl)propyl)amino)benzyl)-5-(trifluoromethyl)pyridin-2(1H)-one, an orally active multi-target agent for the treatment of diabetic nephropathy.,  28  (2): [PMID:29248299] [10.1016/j.bmcl.2017.07.001]

Source