N-isopropyl-N-((3-(naphthalen-2-yl)-1,2,4-oxadiazol-5-yl)methyl)benzofuran-2-carboxamide

ID: ALA4776187

PubChem CID: 162643573

Max Phase: Preclinical

Molecular Formula: C25H21N3O3

Molecular Weight: 411.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)N(Cc1nc(-c2ccc3ccccc3c2)no1)C(=O)c1cc2ccccc2o1

Standard InChI:  InChI=1S/C25H21N3O3/c1-16(2)28(25(29)22-14-19-9-5-6-10-21(19)30-22)15-23-26-24(27-31-23)20-12-11-17-7-3-4-8-18(17)13-20/h3-14,16H,15H2,1-2H3

Standard InChI Key:  MSRGALXESAOGFA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   17.5118  -26.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2195  -26.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9314  -26.5628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6432  -26.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3550  -26.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9314  -27.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2195  -27.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6432  -27.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2195  -25.3288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4400  -27.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2435  -27.5455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6563  -26.8336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1052  -26.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7594  -26.2346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4205  -27.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6170  -27.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2114  -26.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3922  -26.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9776  -27.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3923  -28.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2102  -28.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5724  -28.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0901  -28.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4216  -29.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3819  -28.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7160  -29.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2367  -29.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5717  -30.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3858  -30.6079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8637  -29.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5261  -29.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  6  8  1  0
  2  9  2  0
  5 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  5  1  0
  1 14  1  0
 14 17  1  0
 16 15  1  0
 15  1  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 22 23  2  0
 23 24  1  0
 24 27  2  0
 26 25  2  0
 25 22  1  0
 11 22  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776187

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.46Molecular Weight (Monoisotopic): 411.1583AlogP: 5.69#Rotatable Bonds: 5
Polar Surface Area: 72.37Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.20CX LogD: 5.20
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -1.60

References

1. Yang Y,Wang K,Wu B,Yang Y,Lai F,Chen X,Xiao Z.  (2020)  Design, synthesis and biological evaluation of triaryl compounds as novel 20S proteasome inhibitors.,  30  (21.0): [PMID:32853683] [10.1016/j.bmcl.2020.127508]

Source