Butyl 2-(4-methyl-3-oxo-2-(4-(trifluoromethyl)benzoyl)isoindolin-1-yl)acetate

ID: ALA4776198

PubChem CID: 162643646

Max Phase: Preclinical

Molecular Formula: C23H24F3NO3

Molecular Weight: 419.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOCCC1c2cccc(C)c2C(=O)N1C(=O)c1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C23H24F3NO3/c1-3-4-13-30-14-12-19-18-7-5-6-15(2)20(18)22(29)27(19)21(28)16-8-10-17(11-9-16)23(24,25)26/h5-11,19H,3-4,12-14H2,1-2H3

Standard InChI Key:  GUUQCYQQISUKIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   18.7995  -14.0119    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.0141  -13.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2241  -13.4319    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.0549   -9.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8619  -10.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8608  -10.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5688  -11.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5671   -9.6038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2757  -10.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2805  -10.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0649  -11.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5449  -10.4132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3219  -11.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7787  -12.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9784  -12.3029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4351  -12.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6348  -12.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0915  -13.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2912  -13.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5646   -8.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3621  -10.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7752  -11.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7661   -9.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3701  -11.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7825  -12.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6006  -12.5209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0045  -11.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5897  -11.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8318  -13.2192    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.3015   -8.9694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  4  1  0
  4  9  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  8 20  1  0
 12 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 26  2  1  0
  2 29  1  0
  4 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4776198

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.44Molecular Weight (Monoisotopic): 419.1708AlogP: 5.56#Rotatable Bonds: 7
Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.33CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -0.66

References

1. Ma Y,Li X,Pei Y,Ye J,Wei X,Yang J,Si G,Tian J,Dong Y,Liu G.  (2020)  Identification of benzofused five-membered sultams, potent dual NOD1/NOD2 antagonists in vitro and in vivo.,  204  [PMID:32731185] [10.1016/j.ejmech.2020.112575]

Source