The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Butyl 2-(4-methyl-3-oxo-2-(4-(trifluoromethyl)benzoyl)isoindolin-1-yl)acetate ID: ALA4776198
PubChem CID: 162643646
Max Phase: Preclinical
Molecular Formula: C23H24F3NO3
Molecular Weight: 419.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOCCC1c2cccc(C)c2C(=O)N1C(=O)c1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C23H24F3NO3/c1-3-4-13-30-14-12-19-18-7-5-6-15(2)20(18)22(29)27(19)21(28)16-8-10-17(11-9-16)23(24,25)26/h5-11,19H,3-4,12-14H2,1-2H3
Standard InChI Key: GUUQCYQQISUKIG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
18.7995 -14.0119 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.0141 -13.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2241 -13.4319 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.0549 -9.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8619 -10.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8608 -10.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5688 -11.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5671 -9.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2757 -10.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2805 -10.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0649 -11.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5449 -10.4132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3219 -11.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7787 -12.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9784 -12.3029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4351 -12.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6348 -12.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0915 -13.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2912 -13.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5646 -8.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3621 -10.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7752 -11.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7661 -9.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3701 -11.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7825 -12.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6006 -12.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0045 -11.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5897 -11.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8318 -13.2192 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.3015 -8.9694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 4 1 0
4 9 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
8 20 1 0
12 21 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
26 2 1 0
2 29 1 0
4 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.44Molecular Weight (Monoisotopic): 419.1708AlogP: 5.56#Rotatable Bonds: 7Polar Surface Area: 46.61Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.33CX Basic pKa: ┄CX LogP: 5.43CX LogD: 5.43Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -0.66
References 1. Ma Y,Li X,Pei Y,Ye J,Wei X,Yang J,Si G,Tian J,Dong Y,Liu G. (2020) Identification of benzofused five-membered sultams, potent dual NOD1/NOD2 antagonists in vitro and in vivo., 204 [PMID:32731185 ] [10.1016/j.ejmech.2020.112575 ]