The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(7-(4-methyl-1H-imidazol-1-yl)-1H-indol-3-yl)-N-((S)-piperidin-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4776205
PubChem CID: 162643715
Max Phase: Preclinical
Molecular Formula: C22H22F3N7
Molecular Weight: 441.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(-c2cccc3c(-c4nc(N[C@H]5CCCNC5)ncc4C(F)(F)F)c[nH]c23)cn1
Standard InChI: InChI=1S/C22H22F3N7/c1-13-11-32(12-29-13)18-6-2-5-15-16(9-27-20(15)18)19-17(22(23,24)25)10-28-21(31-19)30-14-4-3-7-26-8-14/h2,5-6,9-12,14,26-27H,3-4,7-8H2,1H3,(H,28,30,31)/t14-/m0/s1
Standard InChI Key: KLLLDNLYQNAKOW-AWEZNQCLSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.7774 -6.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7763 -7.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4910 -7.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4892 -5.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2045 -6.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2093 -7.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9968 -7.4814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4786 -6.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9889 -6.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2397 -5.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0470 -5.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2974 -4.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7416 -3.7908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9321 -3.9706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6854 -4.7556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4945 -8.4748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8277 -8.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0837 -9.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9087 -9.7437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -8.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5997 -10.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6020 -5.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3508 -6.5829 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.1826 -5.2079 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3951 -6.0079 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3744 -3.3628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5691 -3.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0148 -2.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2126 -3.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9609 -3.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5178 -4.5025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3264 -4.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
3 16 1 0
18 21 1 0
11 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
14 26 1 0
27 26 1 6
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.46Molecular Weight (Monoisotopic): 441.1889AlogP: 4.30#Rotatable Bonds: 4Polar Surface Area: 83.45Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.92CX Basic pKa: 9.40CX LogP: 3.21CX LogD: 1.22Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.92
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),