The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((3,3-Dimethyl-1-oxo-1,3-dihydroisobenzofuran-5-yl)amino)-4-((2-hydroxy-1-phenylethyl)amino)pyrimidine-5-carboxamide ID: ALA4776227
PubChem CID: 155397763
Max Phase: Preclinical
Molecular Formula: C23H23N5O4
Molecular Weight: 433.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)OC(=O)c2ccc(Nc3ncc(C(N)=O)c(N[C@H](CO)c4ccccc4)n3)cc21
Standard InChI: InChI=1S/C23H23N5O4/c1-23(2)17-10-14(8-9-15(17)21(31)32-23)26-22-25-11-16(19(24)30)20(28-22)27-18(12-29)13-6-4-3-5-7-13/h3-11,18,29H,12H2,1-2H3,(H2,24,30)(H2,25,26,27,28)/t18-/m1/s1
Standard InChI Key: GIRPCUVQSUVBEK-GOSISDBHSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
38.4482 -18.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4471 -19.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1625 -19.5841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8797 -19.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8768 -18.3390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1607 -17.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1583 -17.1037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8722 -16.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8697 -15.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5886 -17.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3025 -16.6844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5855 -15.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5834 -14.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8664 -14.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1502 -14.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1558 -15.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5954 -19.5822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3100 -19.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0224 -19.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0147 -17.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3037 -18.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7355 -18.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7393 -19.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5230 -19.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0037 -18.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5169 -18.0826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7686 -17.2960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3043 -20.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2344 -19.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7302 -17.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7300 -17.1056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0151 -18.3445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 7 1 1
8 9 1 0
8 10 1 0
10 11 1 0
9 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 9 1 0
4 17 1 0
17 18 1 0
18 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 18 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
26 27 2 0
24 28 1 0
24 29 1 0
30 31 2 0
30 32 1 0
1 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.47Molecular Weight (Monoisotopic): 433.1750AlogP: 2.87#Rotatable Bonds: 7Polar Surface Area: 139.46Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.63CX Basic pKa: 3.48CX LogP: 3.08CX LogD: 3.08Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -0.41
References 1. Degnan AP,Kumi GK,Allard CW,Araujo EV,Johnson WL,Zimmermann K,Pearce BC,Sheriff S,Futran A,Li X,Locke GA,You D,Morrison J,Parrish KE,Stromko C,Murtaza A,Liu J,Johnson BM,Vite GD,Wittman MD. (2021) Discovery of Orally Active Isofuranones as Potent, Selective Inhibitors of Hematopoetic Progenitor Kinase 1., 12 (3): [PMID:33732413 ] [10.1021/acsmedchemlett.0c00660 ]