The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(3-(5-((5-tert-butyloxazol-2-yl)methylthio)thiazol-2-ylamino)piperidine-1-carbonyl)piperidin-4-yl)acrylamide ID: ALA4776271
PubChem CID: 137358230
Max Phase: Preclinical
Molecular Formula: C25H36N6O3S2
Molecular Weight: 532.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NC1CCN(C(=O)N2CCCC(Nc3ncc(SCc4ncc(C(C)(C)C)o4)s3)C2)CC1
Standard InChI: InChI=1S/C25H36N6O3S2/c1-5-20(32)28-17-8-11-30(12-9-17)24(33)31-10-6-7-18(15-31)29-23-27-14-22(36-23)35-16-21-26-13-19(34-21)25(2,3)4/h5,13-14,17-18H,1,6-12,15-16H2,2-4H3,(H,27,29)(H,28,32)
Standard InChI Key: GAYYZQYKXQJXQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
34.1838 -12.7439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8900 -12.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6354 -12.6606 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.1799 -12.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7686 -11.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9700 -11.5181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9907 -12.1302 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.3245 -12.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1373 -12.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5478 -13.6658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3469 -13.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4312 -12.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6842 -12.3507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9549 -14.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7861 -14.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7318 -13.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5294 -14.6145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4746 -12.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4765 -11.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7713 -11.1159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0627 -11.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0638 -12.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7735 -12.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7713 -10.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4790 -9.8901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0636 -9.8901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0692 -9.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3655 -8.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6554 -9.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6534 -9.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3616 -10.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9493 -8.6541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2400 -9.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5338 -8.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2369 -9.8772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8246 -9.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 2 0
7 8 1 0
4 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
11 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
1 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.74Molecular Weight (Monoisotopic): 532.2290AlogP: 4.48#Rotatable Bonds: 7Polar Surface Area: 103.60Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.26CX LogP: 2.09CX LogD: 2.09Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.33
References 1. (2020) Inhibitors of cyclin-dependent kinases,