5-((3-fluoro-4-methoxybenzyl)amino)-N-isobutyl-2-morpholinobenzamide

ID: ALA4776275

PubChem CID: 141764492

Max Phase: Preclinical

Molecular Formula: C23H30FN3O3

Molecular Weight: 415.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNc2ccc(N3CCOCC3)c(C(=O)NCC(C)C)c2)cc1F

Standard InChI:  InChI=1S/C23H30FN3O3/c1-16(2)14-26-23(28)19-13-18(5-6-21(19)27-8-10-30-11-9-27)25-15-17-4-7-22(29-3)20(24)12-17/h4-7,12-13,16,25H,8-11,14-15H2,1-3H3,(H,26,28)

Standard InChI Key:  YGHHGNHBARDIRP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    4.5764  -18.1512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4513  -19.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1610  -18.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1581  -18.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4495  -17.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7433  -18.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7445  -18.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0359  -19.3897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3291  -18.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0382  -17.7630    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8643  -17.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2802  -17.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9896  -18.1413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6929  -17.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6856  -16.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9690  -16.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2686  -16.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3899  -16.4965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0938  -16.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7961  -16.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7955  -15.6773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0865  -15.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3781  -15.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4043  -18.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4117  -18.9460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1083  -17.7139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1230  -19.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1304  -20.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8418  -20.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4264  -20.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  7 10  1  0
  4 11  1  0
 11  1  1  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 14 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776275

    ---

Associated Targets(Human)

ALDH2 Tclin Aldehyde dehydrogenase (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.51Molecular Weight (Monoisotopic): 415.2271AlogP: 3.67#Rotatable Bonds: 8
Polar Surface Area: 62.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.86CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -1.75

References

1. Tian W,Guo J,Zhang Q,Fang S,Zhou R,Hu J,Wang M,Zhang Y,Guo JM,Chen Z,Zhu J,Zheng C.  (2021)  The discovery of novel small molecule allosteric activators of aldehyde dehydrogenase 2.,  212  [PMID:33383258] [10.1016/j.ejmech.2020.113119]

Source