3-(1H-Indol-3-yl)-5-(phenylamino)pyridin-2(1H)-one

ID: ALA4776283

PubChem CID: 162642989

Max Phase: Preclinical

Molecular Formula: C19H15N3O

Molecular Weight: 301.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1[nH]cc(Nc2ccccc2)cc1-c1c[nH]c2ccccc12

Standard InChI:  InChI=1S/C19H15N3O/c23-19-16(17-12-20-18-9-5-4-8-15(17)18)10-14(11-21-19)22-13-6-2-1-3-7-13/h1-12,20,22H,(H,21,23)

Standard InChI Key:  KTYFQMCNKIMFBI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   25.9231   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9231   -4.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6284   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3378   -4.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3378   -3.3183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.6284   -2.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6284   -2.0801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6284   -5.3654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3402   -5.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3360   -6.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0470   -7.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7598   -6.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7572   -5.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0456   -5.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2084   -2.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1237   -2.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3176   -1.9270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4627   -3.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9097   -2.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1049   -2.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8518   -3.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4099   -4.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2127   -4.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  6  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  3  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1 15  1  0
 15 16  2  0
 16 17  1  0
 17 19  1  0
 18 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776283

    ---

Associated Targets(Human)

PRKCG Tchem Protein kinase C gamma (2471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 301.35Molecular Weight (Monoisotopic): 301.1215AlogP: 4.27#Rotatable Bonds: 3
Polar Surface Area: 60.68Molecular Species: NEUTRALHBA: 2HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.97CX Basic pKa: 0.51CX LogP: 2.82CX LogD: 2.82
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.53Np Likeness Score: -0.42

References

1. Visseq,A.; Descheemaeker,A.; Pinto-Pardo,N.; Nauton,L.; Théry,V.; Giraud,F.; Abrunhosa-Thomas,I.; Artola,A.; Anizon,F.; Dallel,R.; Moreau,P..  (2020)  Pyridin-2(1H)one derivatives: A possible new class of therapeutics for mechanical allodynia.,  187  [PMID:31806536] [10.1016/j.ejmech.2019.111917]

Source