(S)-1-(4-Benzyl-piperidin-1-yl)-2-dibutylamino-3-(1H-indol-3-yl)-propan-1-one

ID: ALA4776346

PubChem CID: 162643441

Max Phase: Preclinical

Molecular Formula: C31H43N3O

Molecular Weight: 473.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCN(CCCC)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC(Cc2ccccc2)CC1

Standard InChI:  InChI=1S/C31H43N3O/c1-3-5-18-33(19-6-4-2)30(23-27-24-32-29-15-11-10-14-28(27)29)31(35)34-20-16-26(17-21-34)22-25-12-8-7-9-13-25/h7-15,24,26,30,32H,3-6,16-23H2,1-2H3/t30-/m0/s1

Standard InChI Key:  ASLZFWPWGCTKQN-PMERELPUSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    4.1176   -5.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1164   -6.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8245   -7.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8227   -5.5673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5313   -5.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5361   -6.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3161   -7.0397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3084   -5.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5563   -4.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3546   -4.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6026   -3.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4009   -3.8086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0522   -3.3791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9494   -4.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7447   -4.2449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9968   -3.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4472   -2.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6456   -3.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7958   -3.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3438   -3.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0884   -4.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6357   -5.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4356   -5.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6853   -4.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1363   -3.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9050   -5.3660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6570   -6.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7033   -5.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8587   -6.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2074   -6.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2537   -5.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0520   -5.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6024   -6.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9595   -7.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5098   -8.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7 29  1  0
 29  8  2  0
  8  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 12 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 10 26  1  1
 26 27  1  0
 26 28  1  0
 27 30  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 30 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776346

    ---

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACHE Tclin Acetylcholinesterase (18204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.71Molecular Weight (Monoisotopic): 473.3406AlogP: 6.46#Rotatable Bonds: 12
Polar Surface Area: 39.34Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.02CX LogP: 7.00CX LogD: 5.37
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.45

References

1. Meden A,Knez D,Malikowska-Racia N,Brazzolotto X,Nachon F,Svete J,Sałat K,Grošelj U,Gobec S.  (2020)  Structure-activity relationship study of tryptophan-based butyrylcholinesterase inhibitors.,  208  [PMID:32919297] [10.1016/j.ejmech.2020.112766]

Source