The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-Benzyl-piperidin-1-yl)-2-dibutylamino-3-(1H-indol-3-yl)-propan-1-one ID: ALA4776346
PubChem CID: 162643441
Max Phase: Preclinical
Molecular Formula: C31H43N3O
Molecular Weight: 473.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(CCCC)[C@@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC(Cc2ccccc2)CC1
Standard InChI: InChI=1S/C31H43N3O/c1-3-5-18-33(19-6-4-2)30(23-27-24-32-29-15-11-10-14-28(27)29)31(35)34-20-16-26(17-21-34)22-25-12-8-7-9-13-25/h7-15,24,26,30,32H,3-6,16-23H2,1-2H3/t30-/m0/s1
Standard InChI Key: ASLZFWPWGCTKQN-PMERELPUSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
4.1176 -5.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1164 -6.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8245 -7.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8227 -5.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5313 -5.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5361 -6.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3161 -7.0397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3084 -5.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5563 -4.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3546 -4.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6026 -3.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4009 -3.8086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0522 -3.3791 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9494 -4.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7447 -4.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9968 -3.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4472 -2.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6456 -3.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7958 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3438 -3.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0884 -4.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6357 -5.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4356 -5.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6853 -4.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1363 -3.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9050 -5.3660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6570 -6.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7033 -5.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8587 -6.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2074 -6.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2537 -5.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0520 -5.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6024 -6.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9595 -7.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5098 -8.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 29 1 0
29 8 2 0
8 5 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 26 1 1
26 27 1 0
26 28 1 0
27 30 1 0
28 31 1 0
31 32 1 0
32 33 1 0
30 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.71Molecular Weight (Monoisotopic): 473.3406AlogP: 6.46#Rotatable Bonds: 12Polar Surface Area: 39.34Molecular Species: BASEHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.02CX LogP: 7.00CX LogD: 5.37Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -0.45
References 1. Meden A,Knez D,Malikowska-Racia N,Brazzolotto X,Nachon F,Svete J,Sałat K,Grošelj U,Gobec S. (2020) Structure-activity relationship study of tryptophan-based butyrylcholinesterase inhibitors., 208 [PMID:32919297 ] [10.1016/j.ejmech.2020.112766 ]