N-isopropyl-2-(4-propylphenoxy)-N-(4-(pyridin-3-yl)benzyl)acetamide

ID: ALA4776351

PubChem CID: 162643443

Max Phase: Preclinical

Molecular Formula: C26H30N2O2

Molecular Weight: 402.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1ccc(OCC(=O)N(Cc2ccc(-c3cccnc3)cc2)C(C)C)cc1

Standard InChI:  InChI=1S/C26H30N2O2/c1-4-6-21-10-14-25(15-11-21)30-19-26(29)28(20(2)3)18-22-8-12-23(13-9-22)24-7-5-16-27-17-24/h5,7-17,20H,4,6,18-19H2,1-3H3

Standard InChI Key:  NKUZKQCFBRZXTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   21.9816   -9.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6935   -9.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4053   -9.9219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1171   -9.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8290   -9.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4053  -10.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6935  -11.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1171  -11.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6935   -8.6878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2698   -9.5091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5579   -9.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8508   -9.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1395   -9.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1390  -10.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8558  -11.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5601  -10.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4277  -11.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7153  -10.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0040  -11.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8251  -10.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5361  -11.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2505  -10.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2493   -9.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5377   -9.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9576  -11.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9559  -11.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6626  -12.3830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3715  -11.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3692  -11.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6620  -10.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  3  6  1  0
  6  7  1  0
  6  8  1  0
  2  9  2  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
  5 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24  5  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 22 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776351

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2307AlogP: 5.52#Rotatable Bonds: 9
Polar Surface Area: 42.43Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.73CX LogP: 5.26CX LogD: 5.26
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.35

References

1. Yang Y,Wang K,Wu B,Yang Y,Lai F,Chen X,Xiao Z.  (2020)  Design, synthesis and biological evaluation of triaryl compounds as novel 20S proteasome inhibitors.,  30  (21.0): [PMID:32853683] [10.1016/j.bmcl.2020.127508]

Source