2-(3,4-Dihydro-1-phenyl-1H-pyrido[3,4-b]indol-2(9H)-yl)-N-(naphthalen-1-yl)acetamide

ID: ALA4776364

PubChem CID: 162643578

Max Phase: Preclinical

Molecular Formula: C29H25N3O

Molecular Weight: 431.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CN1CCc2c([nH]c3ccccc23)C1c1ccccc1)Nc1cccc2ccccc12

Standard InChI:  InChI=1S/C29H25N3O/c33-27(30-25-16-8-12-20-9-4-5-13-22(20)25)19-32-18-17-24-23-14-6-7-15-26(23)31-28(24)29(32)21-10-2-1-3-11-21/h1-16,29,31H,17-19H2,(H,30,33)

Standard InChI Key:  RGRQPEDFCPVGDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    3.0700  -20.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5888  -20.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9228  -21.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8850  -20.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2259  -21.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7422  -21.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2291  -22.4793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0091  -21.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0091  -22.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7173  -22.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4341  -22.2240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4342  -21.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7173  -20.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1454  -22.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8578  -22.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5691  -22.6397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8589  -21.4047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2815  -22.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7037  -21.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9874  -20.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2784  -21.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7183  -23.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0084  -23.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0070  -24.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7146  -25.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4294  -24.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4274  -23.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7021  -22.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9919  -22.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9907  -23.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6989  -23.8651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4057  -23.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4034  -22.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 29  2  0
 28 19  2  0
 19 20  1  0
 20 21  2  0
 21 18  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 10 22  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776364

    ---

Associated Targets(non-human)

Leishmania infantum (5912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Splenocyte (1641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.54Molecular Weight (Monoisotopic): 431.1998AlogP: 5.91#Rotatable Bonds: 4
Polar Surface Area: 48.13Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.86CX Basic pKa: 5.46CX LogP: 5.66CX LogD: 5.65
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.89

References

1. Ashok P,Chander S,Tejería A,García-Calvo L,Balaña-Fouce R,Murugesan S.  (2016)  Synthesis and anti-leishmanial evaluation of 1-phenyl-2,3,4,9-tetrahydro-1H-β-carboline derivatives against Leishmania infantum.,  123  [PMID:27541264] [10.1016/j.ejmech.2016.08.014]

Source