The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(7-(1,3-dimethyl-1H-pyrazol-4-yl)-1H-indol-3-yl)-N-((S)-piperidin-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4776427
PubChem CID: 162643867
Max Phase: Preclinical
Molecular Formula: C23H24F3N7
Molecular Weight: 455.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(C)cc1-c1cccc2c(-c3nc(N[C@H]4CCCNC4)ncc3C(F)(F)F)c[nH]c12
Standard InChI: InChI=1S/C23H24F3N7/c1-13-18(12-33(2)32-13)16-7-3-6-15-17(10-28-20(15)16)21-19(23(24,25)26)11-29-22(31-21)30-14-5-4-8-27-9-14/h3,6-7,10-12,14,27-28H,4-5,8-9H2,1-2H3,(H,29,30,31)/t14-/m0/s1
Standard InChI Key: KSAUNOLTTIRZDD-AWEZNQCLSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
38.8836 -20.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8825 -21.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5972 -21.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5954 -20.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3107 -20.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3156 -21.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1031 -21.5847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5849 -20.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0952 -20.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3459 -19.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1532 -19.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4037 -18.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8479 -17.8941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0383 -18.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7916 -18.8589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4806 -17.4660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6753 -17.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1179 -17.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3157 -17.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0640 -17.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6209 -18.6024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4296 -18.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7082 -19.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4571 -20.6863 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.4180 -19.4821 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.4180 -20.3112 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.6007 -22.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9340 -23.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1900 -23.8481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0149 -23.8470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2687 -23.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1491 -22.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5008 -24.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
14 16 1 0
17 16 1 6
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
11 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 27 2 0
3 27 1 0
28 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.49Molecular Weight (Monoisotopic): 455.2045AlogP: 4.52#Rotatable Bonds: 4Polar Surface Area: 83.45Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.67CX Basic pKa: 9.40CX LogP: 3.52CX LogD: 1.54Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.09
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),