N-((3,4-dihydro-2H-benzo[b][1,4]dioxepin-6-yl)methyl)-N-(2-(methylamino)-2-oxoethyl)-5-(pyrrolidine-1-carbonyl)-1H-pyrrole-3-carboxamide

ID: ALA4776433

PubChem CID: 162642911

Max Phase: Preclinical

Molecular Formula: C23H28N4O5

Molecular Weight: 440.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)CN(Cc1cccc2c1OCCCO2)C(=O)c1c[nH]c(C(=O)N2CCCC2)c1

Standard InChI:  InChI=1S/C23H28N4O5/c1-24-20(28)15-27(14-16-6-4-7-19-21(16)32-11-5-10-31-19)22(29)17-12-18(25-13-17)23(30)26-8-2-3-9-26/h4,6-7,12-13,25H,2-3,5,8-11,14-15H2,1H3,(H,24,28)

Standard InChI Key:  PERFIICOIOCDTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   27.0954  -13.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7526  -14.3301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4188  -13.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1721  -13.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3558  -13.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3159  -14.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7137  -13.5372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8073  -12.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0639  -12.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5114  -12.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9134  -13.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1385  -14.8874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6568  -12.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4716  -12.5115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9557  -11.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6320  -11.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8191  -11.0141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3300  -11.6720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1191  -10.4507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7966  -13.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6084  -13.3548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2280  -13.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8989  -12.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0888  -12.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7945   -9.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7402  -14.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9311  -14.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4446  -14.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0628  -14.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5467  -15.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7735  -15.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1334  -15.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  6 12  2  0
  4 13  1  0
 13 14  1  0
 13 18  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 19  1  0
 14 20  1  0
 20 21  1  0
 21 27  2  0
 26 22  2  0
 22 23  1  0
 23 24  2  0
 24 21  1  0
 19 25  1  0
 26 27  1  0
 26 29  1  0
 27 28  1  0
 28 30  1  0
 29 31  1  0
 30 32  1  0
 32 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776433

    ---

Associated Targets(Human)

TAB1 Tchem TAK1/TAB1 (257 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.2060AlogP: 1.80#Rotatable Bonds: 6
Polar Surface Area: 103.97Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.14CX Basic pKa: CX LogP: 0.17CX LogD: 0.17
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -1.59

References

1. Veerman JJN,Bruseker YB,Damen E,Heijne EH,van Bruggen W,Hekking KFW,Winkel R,Hupp CD,Keefe AD,Liu J,Thomson HA,Zhang Y,Cuozzo JW,McRiner AJ,Mulvihill MJ,van Rijnsbergen P,Zech B,Renzetti LM,Babiss L,Müller G.  (2021)  Discovery of 2,4-1H-Imidazole Carboxamides as Potent and Selective TAK1 Inhibitors.,  12  (4.0): [PMID:33859795] [10.1021/acsmedchemlett.0c00547]

Source