The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-Methoxy-5-(2-methyl-5-(4-(piperazin-1-yl)phenyl)pyridin-3-yl)phenyl)ethanesulfonamide ID: ALA4776443
PubChem CID: 135348442
Max Phase: Preclinical
Molecular Formula: C25H30N4O3S
Molecular Weight: 466.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)Nc1cc(OC)cc(-c2cc(-c3ccc(N4CCNCC4)cc3)cnc2C)c1
Standard InChI: InChI=1S/C25H30N4O3S/c1-4-33(30,31)28-22-13-20(14-24(16-22)32-3)25-15-21(17-27-18(25)2)19-5-7-23(8-6-19)29-11-9-26-10-12-29/h5-8,13-17,26,28H,4,9-12H2,1-3H3
Standard InChI Key: QKIQUHJMKMTYPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.0283 -9.3948 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.4389 -8.6913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6217 -8.6907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4448 -8.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4437 -9.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1517 -9.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8614 -9.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8586 -8.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1499 -8.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5697 -9.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5662 -10.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2737 -11.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9817 -10.6181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9778 -9.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2697 -9.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6834 -9.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3886 -9.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0937 -9.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0900 -8.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3753 -8.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6731 -8.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7951 -8.1503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5055 -8.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2085 -8.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2075 -7.3310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4973 -6.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7881 -7.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8578 -11.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7356 -9.8039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1475 -7.3503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8540 -6.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3202 -9.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6128 -9.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
11 28 1 0
5 29 1 0
9 30 1 0
30 31 1 0
29 1 1 0
1 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.61Molecular Weight (Monoisotopic): 466.2039AlogP: 3.90#Rotatable Bonds: 7Polar Surface Area: 83.56Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.48CX Basic pKa: 8.75CX LogP: 2.11CX LogD: 1.00Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -1.34
References 1. Suebsuwong C,Dai B,Pinkas DM,Duddupudi AL,Li L,Bufton JC,Schlicher L,Gyrd-Hansen M,Hu M,Bullock AN,Degterev A,Cuny GD. (2020) Receptor-interacting protein kinase 2 (RIPK2) and nucleotide-binding oligomerization domain (NOD) cell signaling inhibitors based on a 3,5-diphenyl-2-aminopyridine scaffold., 200 [PMID:32505849 ] [10.1016/j.ejmech.2020.112417 ]