5-[3-(dimethylamino)propyl]-2,3-dimethoxy-11-methyl-benzo[c][1,5]benzodiazocine-6,12-dione

ID: ALA4776459

PubChem CID: 162643132

Max Phase: Preclinical

Molecular Formula: C22H27N3O4

Molecular Weight: 397.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)N(CCCN(C)C)C(=O)c1ccccc1N(C)C2=O

Standard InChI:  InChI=1S/C22H27N3O4/c1-23(2)11-8-12-25-18-14-20(29-5)19(28-4)13-16(18)21(26)24(3)17-10-7-6-9-15(17)22(25)27/h6-7,9-10,13-14H,8,11-12H2,1-5H3

Standard InChI Key:  BTINBLMUGKVVKY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   13.3337  -20.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3325  -21.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0406  -21.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0388  -20.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1565  -21.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3379  -21.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7542  -21.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7474  -20.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3214  -19.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1400  -19.8893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7221  -20.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7306  -21.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4431  -21.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1476  -21.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1351  -20.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4221  -20.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4755  -22.6180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9241  -22.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1069  -22.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6925  -23.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8754  -23.2670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4610  -23.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4726  -22.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0024  -19.1438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4468  -19.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6259  -20.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6257  -19.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6245  -21.7110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9171  -21.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  7  2  0
  8  4  2  0
  4  1  1  0
 12  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 17  2  0
  6 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
  9 24  2  0
 10 25  1  0
  1 26  1  0
 26 27  1  0
  2 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776459

    ---

Associated Targets(Human)

SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HRH1 Tclin Histamine H1 receptor (7573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.48Molecular Weight (Monoisotopic): 397.2002AlogP: 2.89#Rotatable Bonds: 6
Polar Surface Area: 62.32Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.30CX LogP: 1.68CX LogD: -0.22
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -0.61

References

1. Bieszczad B,Siwek A,Wilczek M,Trzybiński D,Woźniak K,Satała G,Bojarski AJ,Mieczkowski A.  (2020)  Synthesis, crystal structure and biological activity of novel analogues of tricyclic drugs.,  30  (21.0): [PMID:32798652] [10.1016/j.bmcl.2020.127493]

Source