The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[3-(dimethylamino)propyl]-2,3-dimethoxy-11-methyl-benzo[c][1,5]benzodiazocine-6,12-dione ID: ALA4776459
PubChem CID: 162643132
Max Phase: Preclinical
Molecular Formula: C22H27N3O4
Molecular Weight: 397.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)N(CCCN(C)C)C(=O)c1ccccc1N(C)C2=O
Standard InChI: InChI=1S/C22H27N3O4/c1-23(2)11-8-12-25-18-14-20(29-5)19(28-4)13-16(18)21(26)24(3)17-10-7-6-9-15(17)22(25)27/h6-7,9-10,13-14H,8,11-12H2,1-5H3
Standard InChI Key: BTINBLMUGKVVKY-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
13.3337 -20.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3325 -21.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0406 -21.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0388 -20.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1565 -21.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3379 -21.8725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7542 -21.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7474 -20.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3214 -19.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1400 -19.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7221 -20.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7306 -21.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4431 -21.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1476 -21.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1351 -20.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4221 -20.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4755 -22.6180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9241 -22.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1069 -22.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6925 -23.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8754 -23.2670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4610 -23.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4726 -22.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0024 -19.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4468 -19.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6259 -20.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6257 -19.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6245 -21.7110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9171 -21.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 7 2 0
8 4 2 0
4 1 1 0
12 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 17 2 0
6 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
9 24 2 0
10 25 1 0
1 26 1 0
26 27 1 0
2 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.48Molecular Weight (Monoisotopic): 397.2002AlogP: 2.89#Rotatable Bonds: 6Polar Surface Area: 62.32Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.30CX LogP: 1.68CX LogD: -0.22Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -0.61
References 1. Bieszczad B,Siwek A,Wilczek M,Trzybiński D,Woźniak K,Satała G,Bojarski AJ,Mieczkowski A. (2020) Synthesis, crystal structure and biological activity of novel analogues of tricyclic drugs., 30 (21.0): [PMID:32798652 ] [10.1016/j.bmcl.2020.127493 ]