4-(5-(3,5-Bis(trifluoromethyl)benzamido)-1H-indol-1-yl)-N-methylpyridine-2-carboxamide

ID: ALA4776487

PubChem CID: 162643196

Max Phase: Preclinical

Molecular Formula: C24H16F6N4O2

Molecular Weight: 506.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(-n2ccc3cc(NC(=O)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)ccn1

Standard InChI:  InChI=1S/C24H16F6N4O2/c1-31-22(36)19-12-18(4-6-32-19)34-7-5-13-10-17(2-3-20(13)34)33-21(35)14-8-15(23(25,26)27)11-16(9-14)24(28,29)30/h2-12H,1H3,(H,31,36)(H,33,35)

Standard InChI Key:  MXTMBVXPLWBABL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    4.3741   -4.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0866   -4.6788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3729   -3.4459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7978   -4.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5090   -4.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5014   -3.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7936   -3.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2189   -3.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2166   -4.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9968   -4.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4829   -3.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0004   -3.1924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2541   -2.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0593   -2.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3182   -1.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7687   -0.8539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9612   -1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7102   -1.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1222   -1.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6671   -1.9095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4711   -1.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3773   -0.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6695   -4.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9567   -4.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2460   -4.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2469   -5.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9643   -5.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6721   -5.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9685   -6.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2587   -7.1453    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6824   -7.1381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9634   -7.5487    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5337   -4.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5328   -3.4449    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8223   -4.6797    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8172   -3.8548    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  2  0
  5  9  1  0
  8  6  1  0
  6  7  2  0
  7  4  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 13  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  1 23  1  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
 25 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776487

    ---

Associated Targets(Human)

Hep 3B2 (2332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.41Molecular Weight (Monoisotopic): 506.1177AlogP: 5.68#Rotatable Bonds: 4
Polar Surface Area: 76.02Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.65CX LogP: 5.04CX LogD: 5.04
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.41

References

1. Sbenati RM,Zaraei SO,El-Gamal MI,Anbar HS,Tarazi H,Zoghbor MM,Mohamood NA,Khakpour MM,Zaher DM,Omar HA,Alach NN,Shehata MK,El-Gamal R.  (2021)  Design, synthesis, biological evaluation, and modeling studies of novel conformationally-restricted analogues of sorafenib as selective kinase-inhibitory antiproliferative agents against hepatocellular carcinoma cells.,  210  [PMID:33310290] [10.1016/j.ejmech.2020.113081]

Source