The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(isopropylamino)-1-(4-(7-methyl-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-c]pyrimidin-4-yl)piperazin-1-yl)-2-(p-tolyl)propan-1-one ID: ALA4776552
PubChem CID: 162643589
Max Phase: Preclinical
Molecular Formula: C27H36N6OS
Molecular Weight: 492.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(CNC(C)C)C(=O)N2CCN(c3ncnc4sc5c(c34)CCN(C)C5)CC2)cc1
Standard InChI: InChI=1S/C27H36N6OS/c1-18(2)28-15-22(20-7-5-19(3)6-8-20)27(34)33-13-11-32(12-14-33)25-24-21-9-10-31(4)16-23(21)35-26(24)30-17-29-25/h5-8,17-18,22,28H,9-16H2,1-4H3
Standard InChI Key: DXCVOVKUXMHTHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
18.3000 -25.2616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3000 -26.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7262 -25.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0131 -24.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7262 -26.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0149 -26.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1870 -27.3057 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.3353 -26.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0031 -27.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4830 -28.0459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2991 -27.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6330 -27.2048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1470 -26.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4817 -25.7977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3036 -25.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6347 -24.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1479 -24.2886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3260 -24.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9909 -25.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4856 -23.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3067 -23.4474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9982 -22.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3359 -22.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1806 -22.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6977 -22.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8775 -22.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5389 -23.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0311 -23.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8496 -23.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1570 -22.0242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4905 -21.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5833 -24.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7181 -23.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3116 -21.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0072 -20.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 6 1 0
5 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
13 14 1 0
17 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
22 24 1 0
23 30 1 0
30 31 1 0
1 32 1 0
27 33 1 0
31 34 1 0
31 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.69Molecular Weight (Monoisotopic): 492.2671AlogP: 3.42#Rotatable Bonds: 6Polar Surface Area: 64.60Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.55CX LogP: 3.89CX LogD: 1.74Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -1.65
References 1. Yu M,Zeng M,Pan Z,Wu F,Guo L,He G. (2020) Discovery of novel akt1 inhibitor induces autophagy associated death in hepatocellular carcinoma cells., 189 [PMID:32007668 ] [10.1016/j.ejmech.2020.112076 ]