The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(2-Amino-5-(4-(piperazin-1-yl)phenyl)pyridin-3-yl)-5methoxyphenyl)benzenesulfonamide ID: ALA4776631
PubChem CID: 135348431
Max Phase: Preclinical
Molecular Formula: C28H29N5O3S
Molecular Weight: 515.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NS(=O)(=O)c2ccccc2)cc(-c2cc(-c3ccc(N4CCNCC4)cc3)cnc2N)c1
Standard InChI: InChI=1S/C28H29N5O3S/c1-36-25-16-21(15-23(18-25)32-37(34,35)26-5-3-2-4-6-26)27-17-22(19-31-28(27)29)20-7-9-24(10-8-20)33-13-11-30-12-14-33/h2-10,15-19,30,32H,11-14H2,1H3,(H2,29,31)
Standard InChI Key: JBTJGPURAPMJSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
2.5235 -20.4392 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9341 -19.7358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1169 -19.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9401 -19.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9389 -20.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6470 -20.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3566 -20.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3538 -19.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6452 -19.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0650 -20.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0614 -21.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7689 -22.0723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4770 -21.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4731 -20.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7650 -20.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1787 -20.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8839 -20.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5890 -20.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5853 -19.6079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8705 -19.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1683 -19.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2904 -19.1948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0008 -19.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7038 -19.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7027 -18.3755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9925 -17.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2834 -18.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3531 -22.0724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2309 -20.8484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6428 -18.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3492 -17.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8155 -20.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1068 -20.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4014 -20.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4025 -21.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1105 -22.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8152 -21.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
11 28 1 0
5 29 1 0
9 30 1 0
30 31 1 0
29 1 1 0
1 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.64Molecular Weight (Monoisotopic): 515.1991AlogP: 4.22#Rotatable Bonds: 7Polar Surface Area: 109.58Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.64CX Basic pKa: 8.90CX LogP: 2.69CX LogD: 2.41Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.18
References 1. Suebsuwong C,Dai B,Pinkas DM,Duddupudi AL,Li L,Bufton JC,Schlicher L,Gyrd-Hansen M,Hu M,Bullock AN,Degterev A,Cuny GD. (2020) Receptor-interacting protein kinase 2 (RIPK2) and nucleotide-binding oligomerization domain (NOD) cell signaling inhibitors based on a 3,5-diphenyl-2-aminopyridine scaffold., 200 [PMID:32505849 ] [10.1016/j.ejmech.2020.112417 ]