(S)-4-Oxo-3-phenyl-4-(3-(3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl)azetidin-1-yl)butanoic acid

ID: ALA4776662

PubChem CID: 162643001

Max Phase: Preclinical

Molecular Formula: C24H29N3O3

Molecular Weight: 407.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)C[C@H](C(=O)N1CC(CCCc2ccc3c(n2)NCCC3)C1)c1ccccc1

Standard InChI:  InChI=1S/C24H29N3O3/c28-22(29)14-21(18-7-2-1-3-8-18)24(30)27-15-17(16-27)6-4-10-20-12-11-19-9-5-13-25-23(19)26-20/h1-3,7-8,11-12,17,21H,4-6,9-10,13-16H2,(H,25,26)(H,28,29)/t21-/m0/s1

Standard InChI Key:  PRUDMEXVXGQSAD-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   31.8040   -6.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5094   -7.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8086   -6.0185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5048   -8.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2194   -6.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9248   -7.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6348   -6.8516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9202   -8.0734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7938   -8.4689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7889   -9.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4948   -9.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2072   -9.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2086   -8.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4456   -6.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4456   -7.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1509   -8.1884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1509   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8561   -6.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8527   -7.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5547   -8.1933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2647   -7.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2682   -6.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5617   -6.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9701   -8.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6801   -7.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3855   -8.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0955   -7.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8811   -8.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0971   -7.2375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3089   -7.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  1
  2  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  4  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  4  1  0
 14 15  1  0
 14 17  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 27  1  0
 29  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776662

    ---

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGAV Tchem Integrin alpha-V/beta-5 (589 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.51Molecular Weight (Monoisotopic): 407.2209AlogP: 3.48#Rotatable Bonds: 8
Polar Surface Area: 82.53Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.45CX Basic pKa: 7.52CX LogP: 0.82CX LogD: 0.60
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -0.14

References

1. Lippa RA,Barrett J,Pal S,Rowedder JE,Murphy JA,Barrett TN.  (2020)  Discovery of the first potent and selective αβ integrin inhibitor based on an amide-containing core.,  208  [PMID:32865176] [10.1016/j.ejmech.2020.112719]

Source