The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-(4-methoxypyrimidin-2-yl)anilino]-N-(trideuteriomethyl)pyridazine-3-carboxamide ID: ALA4776752
PubChem CID: 157028757
Max Phase: Preclinical
Molecular Formula: C22H23N7O4
Molecular Weight: 449.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nccc(OC)n2)c1OC
Standard InChI: InChI=1S/C22H23N7O4/c1-23-22(31)18-15(11-16(28-29-18)26-21(30)12-7-8-12)25-14-6-4-5-13(19(14)33-3)20-24-10-9-17(27-20)32-2/h4-6,9-12H,7-8H2,1-3H3,(H,23,31)(H2,25,26,28,30)/i1D3
Standard InChI Key: XRWVUYRJQUAYSL-FIBGUPNXSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
36.3966 -14.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3955 -15.1327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1035 -15.5417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8132 -15.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8103 -14.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1017 -13.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6888 -13.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6886 -13.0876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9812 -14.3135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0993 -13.0871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8058 -12.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5126 -13.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2186 -12.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2166 -11.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5027 -11.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7996 -11.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0890 -11.4598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0831 -10.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5215 -15.5397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2286 -15.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9369 -15.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2273 -14.3128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3481 -16.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7556 -15.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2734 -13.9051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5658 -14.3139 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.2732 -13.0879 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.5626 -13.4960 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.4977 -10.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2044 -10.2257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1994 -9.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4885 -9.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7812 -9.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7896 -10.2371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9046 -8.9964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6148 -9.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
6 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
4 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
23 21 1 0
24 23 1 0
21 24 1 0
9 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
15 29 1 0
31 35 1 0
35 36 1 0
M ISO 3 26 2 27 2 28 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.47Molecular Weight (Monoisotopic): 449.1812AlogP: 2.40#Rotatable Bonds: 8Polar Surface Area: 140.25Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.09CX Basic pKa: 3.73CX LogP: 2.93CX LogD: 2.93Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.36
References 1. Liu C,Lin J,Langevine C,Smith D,Li J,Tokarski JS,Khan J,Ruzanov M,Strnad J,Zupa-Fernandez A,Cheng L,Gillooly KM,Shuster D,Zhang Y,Thankappan A,McIntyre KW,Chaudhry C,Elzinga PA,Chiney M,Chimalakonda A,Lombardo LJ,Macor JE,Carter PH,Burke JR,Weinstein DS. (2021) Discovery of BMS-986202: A Clinical Tyk2 Inhibitor that Binds to Tyk2 JH2., 64 (1.0): [PMID:33370104 ] [10.1021/acs.jmedchem.0c01698 ]