4-(3-(4-(2-cyclopropyl-2-hydroxyethoxy)-3-methylphenyl)pentan-3-yl)-N-(3-(diethylamino)propyl)-1-ethyl-1H-pyrrole-2-carboxamide

ID: ALA4776810

PubChem CID: 162642929

Max Phase: Preclinical

Molecular Formula: C31H49N3O3

Molecular Weight: 511.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1cc(C(CC)(CC)c2ccc(OCC(O)C3CC3)c(C)c2)cn1CC

Standard InChI:  InChI=1S/C31H49N3O3/c1-7-31(8-2,25-15-16-29(23(6)19-25)37-22-28(35)24-13-14-24)26-20-27(34(11-5)21-26)30(36)32-17-12-18-33(9-3)10-4/h15-16,19-21,24,28,35H,7-14,17-18,22H2,1-6H3,(H,32,36)

Standard InChI Key:  ADJBNDZVABXVHL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   37.9106  -10.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9095  -11.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6243  -12.1150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3407  -11.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3379  -10.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6225  -10.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6241  -12.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1948  -12.1141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.0508  -10.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7668  -10.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8598  -11.6849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6674  -11.8534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.0772  -11.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5229  -10.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8993  -11.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3868  -11.7133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2319  -10.2928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4621   -9.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6329   -9.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4733   -9.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5583   -9.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0521  -10.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3847   -9.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4806  -11.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7657  -12.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0058  -12.6058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5234  -13.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2049   -9.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5375   -8.6041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.3577   -8.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0500   -7.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3827   -7.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6903   -7.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0517  -11.6999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7674  -12.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3544  -13.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1794  -13.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 15 16  2  0
 15 17  1  0
 13 15  1  0
  9 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  1  0
 17 22  1  0
 22 23  1  0
  8 24  1  0
 24 25  1  0
 12 26  1  0
 26 27  1  0
 23 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 30 33  1  0
 25 34  1  0
 36 35  1  0
 37 36  1  0
 35 37  1  0
 25 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776810

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.75Molecular Weight (Monoisotopic): 511.3774AlogP: 5.53#Rotatable Bonds: 16
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.84CX LogP: 5.49CX LogD: 3.09
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.81

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source