(R)-(4-(2-methoxyphenyOpiperazin-1-yl)(1-(1-phenylethyl)-1H-imitlazol-5-yl)methanone

ID: ALA4776815

PubChem CID: 162643007

Max Phase: Preclinical

Molecular Formula: C23H26N4O2

Molecular Weight: 390.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1N1CCN(C(=O)c2cncn2[C@H](C)c2ccccc2)CC1

Standard InChI:  InChI=1S/C23H26N4O2/c1-18(19-8-4-3-5-9-19)27-17-24-16-21(27)23(28)26-14-12-25(13-15-26)20-10-6-7-11-22(20)29-2/h3-11,16-18H,12-15H2,1-2H3/t18-/m1/s1

Standard InChI Key:  ZLUWEMAJVNPMHO-GOSISDBHSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    1.3010  -18.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6772  -18.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8386  -19.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6233  -19.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2469  -19.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0823  -18.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0306  -19.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1952  -20.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6337  -20.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0434  -21.5668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8536  -21.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9436  -20.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6611  -20.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500  -18.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6643  -19.3404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3716  -20.5795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3669  -21.3989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0733  -21.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7888  -21.4066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7933  -20.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0822  -20.1662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4953  -21.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4883  -22.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1965  -23.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9120  -22.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9150  -21.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2062  -21.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2095  -20.5941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9229  -20.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  9 10  2  0
  8  9  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
  7 14  1  1
 13 15  2  0
 13 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 22  1  0
 27 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776815

    ---

Associated Targets(Human)

GPBAR1 Tchem G-protein coupled bile acid receptor 1 (1723 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.49Molecular Weight (Monoisotopic): 390.2056AlogP: 3.46#Rotatable Bonds: 5
Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.76CX LogP: 3.02CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.23

References

1. Zhao S,Li X,Wang L,Peng W,Ye W,Li W,Wang YD,Chen WD.  (2021)  Design, synthesis and evaluation of 1-benzyl-1H-imidazole-5-carboxamide derivatives as potent TGR5 agonists.,  32  [PMID:33440321] [10.1016/j.bmc.2020.115972]

Source