4-((2'S,3'S,3a'S,5'R,6a'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-2-oxo-3',3a',4',5',6',6a'-hexahydro-1'H-spiro[indoline-3,2'-pyrrolo[3,2-b]pyrrole]-5'-yl)benzoic acid

ID: ALA4776839

PubChem CID: 118439587

Max Phase: Preclinical

Molecular Formula: C30H26Cl2FN3O3

Molecular Weight: 566.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc([C@H]2C[C@H]3[C@@H](N2)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc4cc(Cl)ccc42)N3CC2CC2)cc1

Standard InChI:  InChI=1S/C30H26Cl2FN3O3/c31-18-10-11-20-23(12-18)35-29(39)30(20)25(19-2-1-3-21(32)26(19)33)27-24(36(30)14-15-4-5-15)13-22(34-27)16-6-8-17(9-7-16)28(37)38/h1-3,6-12,15,22,24-25,27,34H,4-5,13-14H2,(H,35,39)(H,37,38)/t22-,24+,25+,27-,30-/m1/s1

Standard InChI Key:  CCPUFNJKOGKOOG-AFKAWQRRSA-N

Molfile:  

 
     RDKit          2D

 41 47  0  0  0  0  0  0  0  0999 V2000
   35.5400   -5.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3104   -5.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0432   -5.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3466   -6.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3454   -7.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0535   -7.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0517   -5.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7603   -6.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7651   -7.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5451   -7.3120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0225   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8397   -6.6432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6374   -7.4762    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.3303   -4.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3325   -4.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6203   -3.6931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9070   -4.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9103   -4.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6230   -5.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6201   -2.8759    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   36.9834   -6.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7213   -5.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5335   -5.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1823   -5.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5064   -4.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2875   -4.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7457   -4.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2477   -3.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4819   -3.8526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7925   -4.2552    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.1038   -4.8908    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.5408   -3.3100    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.4766   -2.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2690   -2.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4980   -1.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9327   -1.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1354   -1.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9101   -2.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1577   -0.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9561   -0.2453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5931    0.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 26  1  0
 25  3  1  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  1  1  0
  1  8  1  6
 11 12  2  0
  5 13  1  0
  3 14  1  1
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 16 20  1  0
  2 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  1  0
 22 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
 25 30  1  1
 26 31  1  1
 15 32  1  0
 28 33  1  1
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 39 40  1  0
 39 41  2  0
 36 39  1  0
M  END

Associated Targets(Human)

TP53 Tchem Tumour suppressor p53/oncoprotein Mdm2 (2075 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SJSA-1 (970 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-OV-3 (52876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 566.46Molecular Weight (Monoisotopic): 565.1335AlogP: 5.96#Rotatable Bonds: 5
Polar Surface Area: 81.67Molecular Species: ZWITTERIONHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.90CX Basic pKa: 9.66CX LogP: 3.39CX LogD: 3.39
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.36Np Likeness Score: -0.25

References

1. Gollner A,Rudolph D,Arnhof H,Bauer M,Blake SM,Boehmelt G,Cockroft XL,Dahmann G,Ettmayer P,Gerstberger T,Karolyi-Oezguer J,Kessler D,Kofink C,Ramharter J,Rinnenthal J,Savchenko A,Schnitzer R,Weinstabl H,Weyer-Czernilofsky U,Wunberg T,McConnell DB.  (2016)  Discovery of Novel Spiro[3H-indole-3,2'-pyrrolidin]-2(1H)-one Compounds as Chemically Stable and Orally Active Inhibitors of the MDM2-p53 Interaction.,  59  (22): [PMID:27775892] [10.1021/acs.jmedchem.6b00900]

Source