The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((R)-1-(((S)-1-amino-1-oxopropan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxodecanamide ID: ALA4776847
PubChem CID: 162643083
Max Phase: Preclinical
Molecular Formula: C26H41N3O5
Molecular Weight: 475.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@@H](C)C(N)=O
Standard InChI: InChI=1S/C26H41N3O5/c1-7-8-9-10-11-12-23(30)18(2)25(32)29(5)22(26(33)28(4)19(3)24(27)31)17-20-13-15-21(34-6)16-14-20/h13-16,18-19,22H,7-12,17H2,1-6H3,(H2,27,31)/t18-,19+,22-/m1/s1
Standard InChI Key: ZOIUQLDPKXMLLV-XQBPLPMBSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
13.5524 -27.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5513 -28.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2593 -28.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9690 -28.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9661 -27.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2575 -26.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8432 -28.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1358 -28.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6723 -26.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3815 -27.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0877 -26.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3846 -28.0603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6785 -28.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0939 -28.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0969 -29.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8000 -28.0550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3908 -29.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6815 -29.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7969 -27.2378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0846 -26.0147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7908 -25.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3754 -25.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5000 -26.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2062 -25.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5031 -26.8265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7877 -24.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8062 -29.6893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3939 -30.5119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9754 -29.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2661 -29.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5600 -29.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8507 -29.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1446 -29.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4353 -29.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
10 9 1 6
10 11 1 0
10 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
11 19 2 0
11 20 1 0
20 21 1 0
20 22 1 0
21 23 1 0
23 24 1 0
23 25 2 0
21 26 1 1
15 27 1 6
17 28 2 0
18 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.3046AlogP: 2.96#Rotatable Bonds: 15Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.79CX Basic pKa: ┄CX LogP: 3.53CX LogD: 3.53Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: 0.29
References 1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T. (2020) Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity., 83 (8.0): [PMID:32786886 ] [10.1021/acs.jnatprod.0c00441 ]