(R)-N-((R)-1-(((S)-1-amino-1-oxopropan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-N,2-dimethyl-3-oxodecanamide

ID: ALA4776847

PubChem CID: 162643083

Max Phase: Preclinical

Molecular Formula: C26H41N3O5

Molecular Weight: 475.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC(=O)[C@@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@@H](C)C(N)=O

Standard InChI:  InChI=1S/C26H41N3O5/c1-7-8-9-10-11-12-23(30)18(2)25(32)29(5)22(26(33)28(4)19(3)24(27)31)17-20-13-15-21(34-6)16-14-20/h13-16,18-19,22H,7-12,17H2,1-6H3,(H2,27,31)/t18-,19+,22-/m1/s1

Standard InChI Key:  ZOIUQLDPKXMLLV-XQBPLPMBSA-N

Molfile:  

 
     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   13.5524  -27.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5513  -28.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2593  -28.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9690  -28.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9661  -27.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2575  -26.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8432  -28.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1358  -28.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6723  -26.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3815  -27.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0877  -26.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3846  -28.0603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6785  -28.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0939  -28.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0969  -29.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8000  -28.0550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3908  -29.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6815  -29.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7969  -27.2378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0846  -26.0147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7908  -25.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3754  -25.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5000  -26.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2062  -25.5981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5031  -26.8265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7877  -24.7862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8062  -29.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3939  -30.5119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9754  -29.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2661  -29.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5600  -29.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8507  -29.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1446  -29.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4353  -29.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 11 19  2  0
 11 20  1  0
 20 21  1  0
 20 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  1
 15 27  1  6
 17 28  2  0
 18 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776847

    ---

Associated Targets(non-human)

MC3T3-E1 (421 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.3046AlogP: 2.96#Rotatable Bonds: 15
Polar Surface Area: 110.01Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.79CX Basic pKa: CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: 0.29

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source