The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(bis(2-hydroxyethyl)amino)propyl)-1-ethyl-4-(3-(4-(2-hydroxypropoxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide ID: ALA4776851
PubChem CID: 162643154
Max Phase: Preclinical
Molecular Formula: C29H47N3O5
Molecular Weight: 517.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(CC)(CC)c2ccc(OCC(C)O)c(C)c2)cc1C(=O)NCCCN(CCO)CCO
Standard InChI: InChI=1S/C29H47N3O5/c1-6-29(7-2,24-10-11-27(22(4)18-24)37-21-23(5)35)25-19-26(32(8-3)20-25)28(36)30-12-9-13-31(14-16-33)15-17-34/h10-11,18-20,23,33-35H,6-9,12-17,21H2,1-5H3,(H,30,36)
Standard InChI Key: SDEQITKRNDIIKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
1.8959 -21.1920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7570 -20.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7558 -21.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4707 -21.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1871 -21.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1842 -20.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4688 -19.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4705 -22.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0410 -21.6062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8972 -19.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6132 -20.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7063 -21.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5138 -21.3455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9237 -20.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3692 -20.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7458 -20.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2332 -21.2054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0785 -19.7850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3084 -19.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4793 -19.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3491 -18.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4340 -18.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8986 -19.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3268 -21.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6121 -21.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8522 -22.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3699 -22.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6119 -22.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2313 -18.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0514 -18.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3840 -18.0962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2042 -18.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8966 -17.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2292 -16.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7417 -16.0101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5368 -17.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3570 -17.1624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
3 9 1 0
6 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
16 17 2 0
16 18 1 0
14 16 1 0
10 19 1 0
10 20 1 0
20 21 1 0
19 22 1 0
18 23 1 0
9 24 1 0
24 25 1 0
25 1 1 0
13 26 1 0
26 27 1 0
25 28 1 0
23 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
33 34 1 0
34 35 1 0
32 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.71Molecular Weight (Monoisotopic): 517.3516AlogP: 3.09#Rotatable Bonds: 17Polar Surface Area: 107.19Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.76CX LogP: 2.98CX LogD: 1.60Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.84
References 1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C. (2021) Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment., 64 (1.0): [PMID:33381963 ] [10.1021/acs.jmedchem.0c01197 ]