N-(3-(Furan-2-carboxamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide

ID: ALA4776955

PubChem CID: 162643776

Max Phase: Preclinical

Molecular Formula: C28H22N2O4S

Molecular Weight: 482.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccco1

Standard InChI:  InChI=1S/C28H22N2O4S/c31-27(23-13-7-15-33-23)30-21-11-6-10-20(16-21)17-29-28(32)26-25(22-12-4-5-14-24(22)35-26)34-18-19-8-2-1-3-9-19/h1-16H,17-18H2,(H,29,32)(H,30,31)

Standard InChI Key:  KUIKFKVGTYSNAG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    1.4508  -20.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9381  -21.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2357  -21.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0456  -22.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2569  -20.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5590  -21.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3773  -21.3512    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5810  -20.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8885  -20.1178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3407  -20.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9813  -20.7630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4597  -19.4472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7410  -20.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3816  -20.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2613  -21.7747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9011  -22.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6618  -21.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7789  -21.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1379  -20.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5375  -20.8639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1799  -21.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0637  -22.1779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8369  -19.3023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1047  -18.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0531  -18.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7362  -17.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6850  -16.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9523  -16.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2698  -16.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3244  -17.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9406  -21.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6323  -21.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2599  -20.9732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9561  -20.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1408  -20.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
  9 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  1  0
 21 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4776955

    ---

Associated Targets(Human)

SENP1 Tchem Sentrin-specific protease 1 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP2 Tchem Sentrin-specific protease 2 (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP5 Tbio Sentrin-specific protease 5 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.56Molecular Weight (Monoisotopic): 482.1300AlogP: 6.26#Rotatable Bonds: 8
Polar Surface Area: 80.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.73CX Basic pKa: CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -1.58

References

1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H.  (2020)  Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family.,  204  [PMID:32717481] [10.1016/j.ejmech.2020.112553]

Source