The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(Furan-2-carboxamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide ID: ALA4776955
PubChem CID: 162643776
Max Phase: Preclinical
Molecular Formula: C28H22N2O4S
Molecular Weight: 482.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccco1
Standard InChI: InChI=1S/C28H22N2O4S/c31-27(23-13-7-15-33-23)30-21-11-6-10-20(16-21)17-29-28(32)26-25(22-12-4-5-14-24(22)35-26)34-18-19-8-2-1-3-9-19/h1-16H,17-18H2,(H,29,32)(H,30,31)
Standard InChI Key: KUIKFKVGTYSNAG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
1.4508 -20.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9381 -21.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2357 -21.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0456 -22.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2569 -20.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5590 -21.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3773 -21.3512 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5810 -20.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8885 -20.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3407 -20.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9813 -20.7630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4597 -19.4472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7410 -20.4619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3816 -20.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2613 -21.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9011 -22.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6618 -21.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7789 -21.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1379 -20.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5375 -20.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1799 -21.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0637 -22.1779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8369 -19.3023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1047 -18.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0531 -18.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7362 -17.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6850 -16.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9523 -16.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2698 -16.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3244 -17.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9406 -21.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6323 -21.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2599 -20.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9561 -20.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1408 -20.2692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 1 0
21 22 2 0
9 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
21 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.56Molecular Weight (Monoisotopic): 482.1300AlogP: 6.26#Rotatable Bonds: 8Polar Surface Area: 80.57Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: ┄CX LogP: 5.50CX LogD: 5.50Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -1.58
References 1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H. (2020) Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family., 204 [PMID:32717481 ] [10.1016/j.ejmech.2020.112553 ]