The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(6,7-dihydro-5H-cyclopenta[4,5]thieno[2,3-cl]pyrimidin-4-yl)piperazin-1-yl)-3-(isopropylamino)-2-(4-methoxyphenyl)propan-1-one ID: ALA4776972
PubChem CID: 162643828
Max Phase: Preclinical
Molecular Formula: C26H33N5O2S
Molecular Weight: 479.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(CNC(C)C)C(=O)N2CCN(c3ncnc4sc5c(c34)CCC5)CC2)cc1
Standard InChI: InChI=1S/C26H33N5O2S/c1-17(2)27-15-21(18-7-9-19(33-3)10-8-18)26(32)31-13-11-30(12-14-31)24-23-20-5-4-6-22(20)34-25(23)29-16-28-24/h7-10,16-17,21,27H,4-6,11-15H2,1-3H3
Standard InChI Key: IEZODQFELROXIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
34.0397 -18.7574 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.8588 -18.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1922 -18.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0069 -17.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4947 -18.6562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1595 -19.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3404 -19.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3427 -17.2439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1676 -17.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4999 -16.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0114 -15.7293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1865 -15.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8502 -16.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3504 -14.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1745 -14.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8612 -14.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2001 -13.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0242 -13.4566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3590 -12.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1831 -12.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8734 -12.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0407 -14.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5560 -13.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7326 -13.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3929 -14.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8868 -15.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7084 -15.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5689 -14.6506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0800 -13.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5770 -17.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8670 -17.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2539 -17.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5849 -16.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4027 -16.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
16 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
3 30 1 0
31 30 2 0
31 1 1 0
32 31 1 0
33 32 1 0
34 33 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.65Molecular Weight (Monoisotopic): 479.2355AlogP: 3.62#Rotatable Bonds: 7Polar Surface Area: 70.59Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.52CX LogP: 4.25CX LogD: 2.16Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -1.72
References 1. Yu M,Zeng M,Pan Z,Wu F,Guo L,He G. (2020) Discovery of novel akt1 inhibitor induces autophagy associated death in hepatocellular carcinoma cells., 189 [PMID:32007668 ] [10.1016/j.ejmech.2020.112076 ]