3-Acetyl-7-((6-(2-methoxyphenyl)pyrimidin-4-yl)amino)-4-methyl-2H-chromen-2-one

ID: ALA4777022

PubChem CID: 155677583

Max Phase: Preclinical

Molecular Formula: C23H19N3O4

Molecular Weight: 401.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1cc(Nc2ccc3c(C)c(C(C)=O)c(=O)oc3c2)ncn1

Standard InChI:  InChI=1S/C23H19N3O4/c1-13-16-9-8-15(10-20(16)30-23(28)22(13)14(2)27)26-21-11-18(24-12-25-21)17-6-4-5-7-19(17)29-3/h4-12H,1-3H3,(H,24,25,26)

Standard InChI Key:  BPVRBKCKGLCMHX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   18.1336   -1.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1325   -2.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8405   -2.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5502   -2.3048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5474   -1.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8387   -1.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8403   -3.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1328   -3.9371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1322   -4.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8404   -5.1631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5505   -4.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5476   -3.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2596   -5.1566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9659   -4.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6717   -5.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6613   -3.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9584   -3.9310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3754   -3.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3733   -4.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0804   -5.1573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7941   -4.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7961   -3.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0845   -3.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0854   -2.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5052   -3.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5002   -5.1616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2115   -3.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5081   -2.7047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2625   -2.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9686   -2.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 22 25  1  0
 21 26  2  0
 25 27  1  0
 25 28  2  0
  4 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777022

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.42Molecular Weight (Monoisotopic): 401.1376AlogP: 4.51#Rotatable Bonds: 5
Polar Surface Area: 94.32Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.30CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -0.69

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source