2-((3-((6-((4-Bromophenyl)thio)-2-cyano-1-oxo-1H-phenalen-3-yl)amino)propanamido)methyl)benzoic acid

ID: ALA4777045

PubChem CID: 162643089

Max Phase: Preclinical

Molecular Formula: C31H22BrN3O4S

Molecular Weight: 612.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CC1=C(NCCC(=O)NCc2ccccc2C(=O)O)c2ccc(Sc3ccc(Br)cc3)c3cccc(c23)C1=O

Standard InChI:  InChI=1S/C31H22BrN3O4S/c32-19-8-10-20(11-9-19)40-26-13-12-23-28-22(26)6-3-7-24(28)30(37)25(16-33)29(23)34-15-14-27(36)35-17-18-4-1-2-5-21(18)31(38)39/h1-13,34H,14-15,17H2,(H,35,36)(H,38,39)

Standard InChI Key:  WQTHGCHYXVDNIX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    9.4336   -9.9108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1461  -10.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8475   -9.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8404   -9.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8293   -8.2584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5641  -10.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2655   -9.8744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2543   -9.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9557   -8.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9487   -7.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6500   -7.4049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6389   -6.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3403   -6.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0528   -6.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0639   -7.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3626   -7.8085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7765   -7.7903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7583   -6.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7471   -5.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0346   -4.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3332   -5.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2362   -7.4231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5711  -11.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2837  -11.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2948  -12.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5893  -12.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6005  -13.5605    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3130  -13.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3241  -14.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0367  -15.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7422  -14.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4505  -15.1624    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   13.7310  -13.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0185  -13.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8809  -12.3439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8698  -11.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1572  -11.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4518  -11.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4629  -12.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1754  -12.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  3  0
  3  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 14 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 13 21  1  0
 10 22  2  0
  6 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 28 34  1  0
 26 35  1  0
 35 36  2  0
 23 36  1  0
 36 37  1  0
  2 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 35 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777045

    ---

Associated Targets(Human)

BCL2 Tclin Apoptosis regulator Bcl-2 (3787 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 612.51Molecular Weight (Monoisotopic): 611.0514AlogP: 6.18#Rotatable Bonds: 9
Polar Surface Area: 119.29Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.80CX Basic pKa: CX LogP: 5.23CX LogD: 1.97
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.00

References

1. Wang Z,Song T,Guo Z,Cao K,Chen C,Feng Y,Wang H,Yin F,Zhou S,Dai J,Zhang Z.  (2020)  Targeting the Allosteric Pathway That Interconnects the Core-Functional Scaffold and the Distal Phosphorylation Sites for Specific Dephosphorylation of Bcl-2.,  63  (22): [PMID:33197310] [10.1021/acs.jmedchem.0c01290]

Source