2-(1'-cyano-1',2',3',6'-tetrahydro-[2,4'-bipyridin]-5-yl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)acetamide

ID: ALA4777061

PubChem CID: 139558780

Max Phase: Preclinical

Molecular Formula: C19H20N6O

Molecular Weight: 348.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#CN1CC=C(c2ccc(CC(=O)Nc3cc(C4CC4)[nH]n3)cn2)CC1

Standard InChI:  InChI=1S/C19H20N6O/c20-12-25-7-5-15(6-8-25)16-4-1-13(11-21-16)9-19(26)22-18-10-17(23-24-18)14-2-3-14/h1,4-5,10-11,14H,2-3,6-9H2,(H2,22,23,24,26)

Standard InChI Key:  GLBHJLVVSAFXIN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   12.6320   -4.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6309   -5.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3389   -5.4506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0486   -5.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0458   -4.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3371   -3.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7519   -3.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4612   -4.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4642   -5.0304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1673   -3.8019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8766   -4.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9674   -5.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7674   -5.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1733   -4.4772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6242   -3.8720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1036   -5.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0213   -6.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7666   -6.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9264   -5.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2278   -5.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5255   -5.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5204   -6.2530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2239   -6.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9324   -6.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8107   -6.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1005   -7.0617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 11  2  0
 17 16  1  0
 18 17  1  0
 16 18  1  0
 13 16  1  0
  2 19  1  0
 19 20  1  0
 19 24  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4777061

    ---

Associated Targets(Human)

CDK12 Tchem Cyclin-dependent kinase 12 (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.41Molecular Weight (Monoisotopic): 348.1699AlogP: 2.43#Rotatable Bonds: 5
Polar Surface Area: 97.70Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.31CX Basic pKa: 3.52CX LogP: 2.09CX LogD: 2.09
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.81Np Likeness Score: -1.16

References

1.  (2019)  Substituted Pyrazole Derivatives As Selective CDK12/13 Inhibitors, 

Source