(2S,3R)-N-((R)-1-(((S)-1-amino-3-methyl-1-oxobutan-2-yl)(methyl)amino)-3-(4-methoxyphenyl)-1-oxopropan-2-yl)-3-hydroxy-N,2-dimethyldecanamide

ID: ALA4777078

PubChem CID: 162643317

Max Phase: Preclinical

Molecular Formula: C28H47N3O5

Molecular Weight: 505.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC[C@@H](O)[C@H](C)C(=O)N(C)[C@H](Cc1ccc(OC)cc1)C(=O)N(C)[C@H](C(N)=O)C(C)C

Standard InChI:  InChI=1S/C28H47N3O5/c1-8-9-10-11-12-13-24(32)20(4)27(34)30(5)23(18-21-14-16-22(36-7)17-15-21)28(35)31(6)25(19(2)3)26(29)33/h14-17,19-20,23-25,32H,8-13,18H2,1-7H3,(H2,29,33)/t20-,23+,24+,25-/m0/s1

Standard InChI Key:  MSWMRUPSAFXMME-KTJVCJKDSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   30.2718  -12.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2707  -13.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9787  -14.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6884  -13.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6855  -12.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9769  -12.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5626  -14.1458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8552  -13.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3917  -12.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1009  -12.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8071  -12.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1040  -13.7264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3979  -14.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8133  -14.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8163  -14.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5194  -13.7211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1102  -15.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4009  -14.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6948  -15.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9855  -14.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2794  -15.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5701  -14.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8640  -15.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1547  -14.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5164  -12.9039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8040  -11.6808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5102  -11.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0948  -11.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2194  -11.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9256  -11.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2225  -12.4927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5071  -10.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2133  -10.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7979  -10.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1133  -16.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5256  -15.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  5  9  1  0
 10  9  1  6
 10 11  1  0
 10 12  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 11 25  2  0
 11 26  1  0
 26 27  1  0
 26 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 27 32  1  1
 32 33  1  0
 32 34  1  0
 17 35  1  6
 15 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4777078

    ---

Associated Targets(non-human)

MC3T3-E1 (421 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.70Molecular Weight (Monoisotopic): 505.3516AlogP: 3.39#Rotatable Bonds: 16
Polar Surface Area: 113.17Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: 0.66

References

1. Natsume N,Ozaki K,Nakajima D,Yokoshima S,Teruya T.  (2020)  Structure-Activity Relationship Study of Majusculamides A and B and Their Analogues on Osteogenic Activity.,  83  (8.0): [PMID:32786886] [10.1021/acs.jnatprod.0c00441]

Source