(4aR,6R,6aR,9S,11S,11bS,12R,14R)-11b-(acetoxymethyl)-6,11-dihydroxy-4,4-dimethyl-8-methylene-7-oxotetradecahydro-6a,9-methanocyclohepta[a]naphthalen-12-yl-4-bromobenzoate

ID: ALA4777178

PubChem CID: 162643886

Max Phase: Preclinical

Molecular Formula: C29H35BrO7

Molecular Weight: 575.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CCC[C@@]4(COC(C)=O)[C@@H]2[C@@H](O)C[C@H]1[C@H]3OC(=O)c1ccc(Br)cc1

Standard InChI:  InChI=1S/C29H35BrO7/c1-15-19-12-20(32)23-28(14-36-16(2)31)11-5-10-27(3,4)21(28)13-22(33)29(23,24(15)34)25(19)37-26(35)17-6-8-18(30)9-7-17/h6-9,19-23,25,32-33H,1,5,10-14H2,2-4H3/t19-,20+,21-,22-,23+,25-,28+,29-/m1/s1

Standard InChI Key:  IVIKUWORDFOYHN-PGSPYRNJSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   27.9207  -13.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5162  -13.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1073  -13.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2261  -11.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6500  -11.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2261  -12.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9360  -11.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3640  -11.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5162  -11.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3640  -10.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9360  -13.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9360  -10.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6500  -12.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8022  -12.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6500  -10.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8022  -11.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2261  -11.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9360  -12.3899    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.2261  -13.6240    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.8593  -11.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4424  -12.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5460   -9.9383    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.5184  -10.7432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5184   -9.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8107   -9.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2261   -9.5174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2291  -10.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8336  -12.7525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0718  -11.9729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3587  -13.2054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4742  -12.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0635  -13.3812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6703  -11.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2890  -12.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6917  -13.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5057  -13.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9147  -12.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5038  -11.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6912  -11.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7319  -12.6797    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  7  1  0
  6  4  1  0
  7  4  1  0
  2  6  1  0
  8  5  1  0
  9  4  1  0
 10 15  1  0
 11  6  1  0
 12  7  1  0
 13  5  1  0
 14 16  1  0
 15 12  1  0
 16  9  1  0
  4 17  1  6
  7 18  1  1
  6 19  1  1
 14  2  1  0
 13 11  1  0
 10  8  1  0
 10 20  1  0
  5 21  1  1
 21 20  1  0
 10 22  1  1
 17 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 12 27  1  1
 21 28  2  0
  8 29  1  1
 13 30  1  6
 29 31  1  0
 31 32  2  0
 31 34  1  0
 20 33  2  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 37 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777178

    ---

Associated Targets(Human)

ECa-109 cell line (1254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TE-1 (337 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGC-803 (6426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.50Molecular Weight (Monoisotopic): 574.1566AlogP: 4.24#Rotatable Bonds: 4
Polar Surface Area: 110.13Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.19CX LogD: 4.19
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: 2.51

References

1. Huo JF,Hu TX,Dong YL,Zhao JZ,Liu XJ,Li LL,Zhang XY,Li YF,Liu HM,Ke Y,Wang C.  (2020)  Synthesis and in vitro and in vivo biological evaluation of novel derivatives of flexicaulin A as antiproliferative agents.,  208  [PMID:32883640] [10.1016/j.ejmech.2020.112789]

Source