palauolol

ID: ALA477722

PubChem CID: 44584726

Max Phase: Preclinical

Molecular Formula: C25H38O4

Molecular Weight: 402.58

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Palauolol | CHEMBL477722

Canonical SMILES:  C=C1CCC[C@@H]2[C@@](C)(CC/C(C)=C/C[C@@H](O)C3=CC(=O)OC3O)[C@@H](C)CC[C@@]12C

Standard InChI:  InChI=1S/C25H38O4/c1-16(9-10-20(26)19-15-22(27)29-23(19)28)11-13-24(4)18(3)12-14-25(5)17(2)7-6-8-21(24)25/h9,15,18,20-21,23,26,28H,2,6-8,10-14H2,1,3-5H3/b16-9+/t18-,20+,21+,23?,24-,25-/m0/s1

Standard InChI Key:  BSFHWMNYTJRBTJ-MYNQIBPASA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -2.8078  -10.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8078  -11.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0947  -11.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0947   -9.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3815  -10.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3850  -11.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6751  -11.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0428  -11.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0463  -10.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6681   -9.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0939  -12.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3929  -12.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3889   -9.5617    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7599   -9.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8897   -9.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2668   -9.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5582   -9.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9748   -8.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7998   -8.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5582   -7.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2082   -7.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0332   -7.8295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4457   -8.5409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4457   -7.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2586   -7.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4284   -6.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7169   -5.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1059   -6.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3026   -6.1948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1786   -5.8934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  2  0
  6 12  1  6
  5 13  1  1
  9 14  1  1
 10 15  1  6
 10 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  6
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 28 29  1  0
 26 30  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA477722

   PALAUOLOL

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 402.58

Molecular Weight (Monoisotopic): 402.2770

AlogP: 5.06

#Rotatable Bonds: 6

Polar Surface Area: 66.76

Molecular Species: ACID

HBA: 4

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 4

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 5.54

CX Basic pKa: ┄

CX LogP: 5.16

CX LogD: 3.31

Aromatic Rings: ┄

Heavy Atoms: 29

QED Weighted: 0.48

Np Likeness Score: 3.56

References

1. Charan RD, McKee TC, Boyd MR..  (2002)  Thorectandrols C, D, and E, new sesterterpenes from the marine sponge Thorectandra sp.,  65  (4): [PMID:11975486] [10.1021/np010439k]

2. Charan RD, McKee TC, Boyd MR..  (2001)  Thorectandrols A and B, new cytotoxic sesterterpenes from the marine sponge Thorectandra species.,  64  (5): [PMID:11374971] [10.1021/np000544e]

Source

Source(1):

• Scientific Literature