(Z)-5-(4,5-dihydro-1H-imidazol-2-yl)-2-(2-(6-(4,5-dihydro-1H-imidazol-2-yl)benzofuran-2-yl)vinyl)-1H-indole

ID: ALA4777245

PubChem CID: 54600486

Max Phase: Preclinical

Molecular Formula: C24H21N5O

Molecular Weight: 395.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C(=C\c1cc2ccc(C3=NCCN3)cc2o1)\c1cc2cc(C3=NCCN3)ccc2[nH]1

Standard InChI:  InChI=1S/C24H21N5O/c1-2-17(24-27-9-10-28-24)14-22-15(1)13-20(30-22)5-4-19-12-18-11-16(3-6-21(18)29-19)23-25-7-8-26-23/h1-6,11-14,29H,7-10H2,(H,25,26)(H,27,28)/b5-4-

Standard InChI Key:  ZFXOXVDKDVUPRJ-PLNGDYQASA-N

Molfile:  

 
     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
   31.7012  -21.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5226  -21.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9312  -20.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2885  -20.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7477  -20.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5985  -19.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6187  -19.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4695  -20.3043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2057  -19.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9162  -19.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6272  -19.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6289  -18.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9137  -17.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2056  -18.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2995  -19.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0111  -19.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0120  -18.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3022  -17.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5899  -18.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5924  -19.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8755  -17.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7878  -17.0553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9839  -16.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5731  -17.5964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1258  -18.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3387  -17.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0893  -18.1895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6404  -17.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2278  -16.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4243  -17.0402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  1  4  1  0
  3  5  2  0
  5 10  1  0
  9  6  1  0
  6  3  1  0
  4  7  2  0
  7 16  1  0
 15  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  2  0
 19 21  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 12 26  1  0
M  END

Associated Targets(Human)

PRMT1 Tchem Protein-arginine N-methyltransferase 1 (867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.47Molecular Weight (Monoisotopic): 395.1746AlogP: 3.78#Rotatable Bonds: 4
Polar Surface Area: 77.71Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.41CX LogP: 2.91CX LogD: -0.27
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -0.05

References

1. Qian, Kun, Yan, Chunli, Su, Hairui, Dang, Tran, Zhou, Bo, Wang, Zhenyu, Zhao, Xinyang, Ivanov, Ivaylo, Ho, Meng-Chiao, Zheng, Y. George.  (2021)  Pharmacophore-based screening of diamidine small molecule inhibitors for protein arginine methyltransferases,  12  (1): [PMID:34046601] [10.1039/d0md00259c]

Source