The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,5'-diallyl-3-((3-fluorophenyl)(piperidin-1-yl)methyl)biphenyl-2,2'-diol ID: ALA4777270
PubChem CID: 162643263
Max Phase: Preclinical
Molecular Formula: C30H32FNO2
Molecular Weight: 457.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(O)c(-c2cc(CC=C)cc(C(c3cccc(F)c3)N3CCCCC3)c2O)c1
Standard InChI: InChI=1S/C30H32FNO2/c1-3-9-21-13-14-28(33)25(17-21)26-18-22(10-4-2)19-27(30(26)34)29(32-15-6-5-7-16-32)23-11-8-12-24(31)20-23/h3-4,8,11-14,17-20,29,33-34H,1-2,5-7,9-10,15-16H2
Standard InChI Key: HVNFDJPTTWSVCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
13.7906 -15.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0522 -15.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9922 -16.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6696 -17.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4091 -16.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4656 -15.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0842 -17.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0260 -18.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7028 -18.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4381 -18.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4926 -17.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8150 -16.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8696 -16.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2002 -15.5936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6456 -19.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9110 -19.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8538 -20.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2563 -17.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5806 -16.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8447 -16.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2257 -16.9543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9049 -17.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8457 -18.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5240 -18.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2581 -18.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3097 -17.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6305 -17.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2797 -16.1389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0148 -15.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0704 -14.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3933 -14.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6584 -14.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6007 -15.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4697 -19.4950 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
12 13 1 0
6 14 1 0
9 15 1 0
15 16 1 0
16 17 2 0
3 18 1 0
18 19 1 0
19 20 2 0
11 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
24 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.59Molecular Weight (Monoisotopic): 457.2417AlogP: 6.94#Rotatable Bonds: 8Polar Surface Area: 43.70Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.70CX Basic pKa: 9.56CX LogP: 6.68CX LogD: 6.32Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -0.10
References 1. Xu T,Zheng Z,Guo Y,Bai LP. (2020) Semisynthesis of novel magnolol-based Mannich base derivatives that suppress cancer cells via inducing autophagy., 205 [PMID:32791403 ] [10.1016/j.ejmech.2020.112663 ]