The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,5'-diallyl-3-((4-methoxyphenyl)(piperidin-1-yl)methyl)biphenyl-2,2'-diol ID: ALA4777286
PubChem CID: 162643324
Max Phase: Preclinical
Molecular Formula: C31H35NO3
Molecular Weight: 469.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(O)c(-c2cc(CC=C)cc(C(c3ccc(OC)cc3)N3CCCCC3)c2O)c1
Standard InChI: InChI=1S/C31H35NO3/c1-4-9-22-11-16-29(33)26(19-22)27-20-23(10-5-2)21-28(31(27)34)30(32-17-7-6-8-18-32)24-12-14-25(35-3)15-13-24/h4-5,11-16,19-21,30,33-34H,1-2,6-10,17-18H2,3H3
Standard InChI Key: HUNFJCISUOLZQV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
13.5388 -8.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8005 -8.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7404 -9.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4179 -10.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1573 -9.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2138 -9.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8324 -10.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7742 -11.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4510 -11.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1864 -11.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2408 -10.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5632 -9.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6178 -9.1090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9485 -8.6557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3938 -12.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6592 -12.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6020 -13.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0046 -10.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3288 -9.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5930 -9.9791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9740 -10.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6532 -10.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5939 -11.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2723 -11.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0064 -11.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0580 -10.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3788 -10.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0279 -9.2010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7630 -8.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8187 -8.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1415 -7.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4067 -7.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3490 -8.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6862 -11.8342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6334 -12.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
12 13 1 0
6 14 1 0
9 15 1 0
15 16 1 0
16 17 2 0
3 18 1 0
18 19 1 0
19 20 2 0
11 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
25 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.63Molecular Weight (Monoisotopic): 469.2617AlogP: 6.81#Rotatable Bonds: 9Polar Surface Area: 52.93Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.70CX Basic pKa: 9.88CX LogP: 6.32CX LogD: 5.91Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: 0.21
References 1. Xu T,Zheng Z,Guo Y,Bai LP. (2020) Semisynthesis of novel magnolol-based Mannich base derivatives that suppress cancer cells via inducing autophagy., 205 [PMID:32791403 ] [10.1016/j.ejmech.2020.112663 ]