N-[6-(2-Adamantan-1-yl-acetylamino)-hexyl]-2-[2,3-dichloro-4-(2-methylene-butyryl)-phenoxy]-acetamide

ID: ALA4777293

PubChem CID: 162643392

Max Phase: Preclinical

Molecular Formula: C31H42Cl2N2O4

Molecular Weight: 577.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(CC)C(=O)c1ccc(OCC(=O)NCCCCCCNC(=O)CC23CC4CC(CC(C4)C2)C3)c(Cl)c1Cl

Standard InChI:  InChI=1S/C31H42Cl2N2O4/c1-3-20(2)30(38)24-8-9-25(29(33)28(24)32)39-19-27(37)35-11-7-5-4-6-10-34-26(36)18-31-15-21-12-22(16-31)14-23(13-21)17-31/h8-9,21-23H,2-7,10-19H2,1H3,(H,34,36)(H,35,37)

Standard InChI Key:  VMSKKQZBLKZSAL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   17.2269  -10.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4013   -9.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7937   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4579   -9.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8772   -8.6857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0777   -8.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9864   -9.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2044   -9.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6449   -9.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2962   -8.5717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0194   -8.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7313   -8.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4390   -8.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1508   -8.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4390   -9.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8626   -8.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1508   -7.3423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8603   -9.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5713   -9.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2841   -9.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2815   -8.5690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5699   -8.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9965   -9.8063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7078   -9.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4161   -9.8044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1274   -9.3907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4172  -10.6257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1516   -9.8014    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.5709  -10.6245    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.8364   -9.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5428   -9.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2518   -9.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9582   -9.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6672   -9.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3736   -9.3773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0826   -9.7837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7890   -9.3729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4980   -9.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7864   -8.5557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 14 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 18 28  1  0
 19 29  1  0
 26 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38  8  1  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4777293

    ---

Associated Targets(Human)

GSTP1 Tchem Glutathione S-transferase Pi (449 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 577.59Molecular Weight (Monoisotopic): 576.2522AlogP: 6.92#Rotatable Bonds: 15
Polar Surface Area: 84.50Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.10CX LogD: 6.10
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.13Np Likeness Score: -0.32

References

1. Li X,Lü Z,Wang C,Li K,Xu F,Xu P,Niu Y.  (2021)  Induction of Apoptosis in Cancer Cells by Glutathione Transferase Inhibitor Mediated Hydrophobic Tagging Molecules.,  12  (5.0): [PMID:34055217] [10.1021/acsmedchemlett.0c00627]
2. Yang, Xinmei X and 10 more authors.  2010-02-11  Novel oxadiazole analogues derived from ethacrynic acid: design, synthesis, and structure-activity relationships in inhibiting the activity of glutathione S-transferase P1-1 and cancer cell proliferation.  [PMID:20055416]

Source