3-Acetyl-7-((4-(2,3-dimethoxyphenyl)pyrimidin-2-yl)amino)-4-morpholino-2H-chromen-2-one

ID: ALA4777326

PubChem CID: 155677588

Max Phase: Preclinical

Molecular Formula: C27H26N4O6

Molecular Weight: 502.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2ccnc(Nc3ccc4c(N5CCOCC5)c(C(C)=O)c(=O)oc4c3)n2)c1OC

Standard InChI:  InChI=1S/C27H26N4O6/c1-16(32)23-24(31-11-13-36-14-12-31)19-8-7-17(15-22(19)37-26(23)33)29-27-28-10-9-20(30-27)18-5-4-6-21(34-2)25(18)35-3/h4-10,15H,11-14H2,1-3H3,(H,28,29,30)

Standard InChI Key:  ZZGFQYIGNMDOFG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   29.5495  -13.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5484  -14.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2564  -14.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9661  -14.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9633  -13.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2547  -13.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2562  -15.5706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5487  -15.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5481  -16.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2563  -17.2022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9664  -16.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9635  -15.9744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6755  -17.1957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3818  -16.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0876  -17.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0772  -15.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3743  -15.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7913  -15.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7892  -16.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4963  -17.1964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2100  -16.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2120  -15.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5004  -15.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5013  -14.7348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9212  -15.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9161  -17.2007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6274  -15.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9240  -14.7439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2156  -14.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2184  -13.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5130  -13.1012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8030  -13.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7985  -14.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6749  -14.7536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3828  -14.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6707  -13.1120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6699  -12.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 22 25  1  0
 21 26  2  0
 25 27  1  0
 25 28  2  0
 24 29  1  0
 24 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
  4 34  1  0
 34 35  1  0
  5 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777326

    ---

Associated Targets(Human)

CCNT1 Tchem CDK9/cyclin T1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.53Molecular Weight (Monoisotopic): 502.1852AlogP: 4.05#Rotatable Bonds: 7
Polar Surface Area: 116.02Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.62CX Basic pKa: 1.48CX LogP: 2.82CX LogD: 2.82
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: -0.80

References

1. Xu J,Li H,Wang X,Huang J,Li S,Liu C,Dong R,Zhu G,Duan C,Jiang F,Zhang Y,Zhu Y,Zhang T,Chen Y,Tang W,Lu T.  (2020)  Discovery of coumarin derivatives as potent and selective cyclin-dependent kinase 9 (CDK9) inhibitors with high antitumour activity.,  200  [PMID:32447197] [10.1016/j.ejmech.2020.112424]

Source