The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-isopropyl-5-methyl-2((4-(piperazin-1-yl)phenyl)amino)imidazo[1',2':1,6]pyrido[2,3-d]pyrimidine-6-carbonitrile ID: ALA4777368
PubChem CID: 162643890
Max Phase: Preclinical
Molecular Formula: C24H26N8
Molecular Weight: 426.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C#N)c2nc(C(C)C)cn2c2nc(Nc3ccc(N4CCNCC4)cc3)ncc12
Standard InChI: InChI=1S/C24H26N8/c1-15(2)21-14-32-22(29-21)19(12-25)16(3)20-13-27-24(30-23(20)32)28-17-4-6-18(7-5-17)31-10-8-26-9-11-31/h4-7,13-15,26H,8-11H2,1-3H3,(H,27,28,30)
Standard InChI Key: DJZJBAJKDQXEMV-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
32.8815 -10.8415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8803 -11.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5951 -12.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5933 -10.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3087 -10.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3095 -11.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7350 -10.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0191 -10.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7398 -11.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0231 -12.0722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1928 -12.8809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0145 -12.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3524 -12.2154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0147 -9.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1655 -12.0808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4514 -11.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4566 -10.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7433 -10.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0275 -10.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0295 -11.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7434 -12.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3129 -10.4298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3106 -9.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6001 -9.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8834 -9.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8818 -10.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5970 -10.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4445 -10.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1564 -9.9965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4252 -13.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0109 -14.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2502 -13.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 2 0
8 14 1 0
2 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 29 3 0
7 28 1 0
12 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.53Molecular Weight (Monoisotopic): 426.2280AlogP: 3.73#Rotatable Bonds: 4Polar Surface Area: 94.17Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.91CX LogP: 3.66CX LogD: 2.14Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -1.35
References 1. Shi C,Wang Q,Liao X,Ge H,Huo G,Zhang L,Chen N,Zhai X,Hong Y,Wang L,Wang Z,Shi W,Mao Y,Yu J,Ke Y,Xia G. (2020) Discovery of a novel series of imidazo[1',2':1,6]pyrido[2,3-d]pyrimidin derivatives as potent cyclin-dependent kinase 4/6 inhibitors., 193 [PMID:32200202 ] [10.1016/j.ejmech.2020.112239 ]