4-((6-Nitro-1H-benzo[d]imidazol-2-yl)amino)benzonitrile

ID: ALA4777400

PubChem CID: 162642963

Max Phase: Preclinical

Molecular Formula: C14H9N5O2

Molecular Weight: 279.26

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(Nc2nc3ccc([N+](=O)[O-])cc3[nH]2)cc1

Standard InChI:  InChI=1S/C14H9N5O2/c15-8-9-1-3-10(4-2-9)16-14-17-12-6-5-11(19(20)21)7-13(12)18-14/h1-7H,(H2,16,17,18)

Standard InChI Key:  UUCQIXJMKKFWIH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   30.3018  -16.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3007  -16.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0153  -17.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0136  -15.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7289  -16.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7291  -16.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5194  -17.0937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0077  -16.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5190  -15.7493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8317  -16.4237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2463  -15.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5867  -15.5978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8724  -16.0104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5865  -14.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0713  -15.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4858  -15.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0790  -14.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2533  -14.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8342  -14.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4964  -13.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9106  -12.8685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 12 13  2  0
 12 14  1  0
  1 12  1  0
 11 15  2  0
 11 19  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 17 20  1  0
 20 21  3  0
M  CHG  2  12   1  14  -1
M  END

Alternative Forms

  1. Parent:

    ALA4777400

    ---

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 279.26Molecular Weight (Monoisotopic): 279.0756AlogP: 3.09#Rotatable Bonds: 3
Polar Surface Area: 107.64Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.96CX Basic pKa: 6.43CX LogP: 3.18CX LogD: 3.13
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.57Np Likeness Score: -1.98

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source