The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((2S,3R,4S,5S)-5-(6-Amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((R)-3-hydroxy-4-((3-((2-mercaptoethyl)amino)-3-oxopropyl)amino)-2,2-dimethyl-4-oxobutyl) succinate ID: ALA4777408
PubChem CID: 162642970
Max Phase: Preclinical
Molecular Formula: C25H37N7O10S
Molecular Weight: 627.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(COC(=O)CCC(=O)OC[C@@H]1O[C@H](n2cnc3c(N)ncnc32)[C@@H](O)[C@H]1O)[C@@H](O)C(=O)NCCC(=O)NCCS
Standard InChI: InChI=1S/C25H37N7O10S/c1-25(2,20(38)23(39)28-6-5-14(33)27-7-8-43)10-41-16(35)4-3-15(34)40-9-13-18(36)19(37)24(42-13)32-12-31-17-21(26)29-11-30-22(17)32/h11-13,18-20,24,36-38,43H,3-10H2,1-2H3,(H,27,33)(H,28,39)(H2,26,29,30)/t13-,18-,19-,20-,24-/m0/s1
Standard InChI Key: DFNKSCRPOZETMX-MTKRSLOGSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
9.9507 -21.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9549 -21.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2451 -21.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9962 -14.5443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9950 -15.3639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7031 -15.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7013 -14.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4099 -14.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4101 -15.3639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1931 -15.6181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6768 -14.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1927 -14.2862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6988 -13.3183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1850 -16.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5160 -16.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7606 -17.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5772 -17.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8371 -16.9237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0510 -18.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7413 -16.6504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2737 -18.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8648 -18.3620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2748 -19.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0920 -19.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8676 -19.7775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5020 -19.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3192 -19.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7292 -20.4795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7264 -19.0641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5464 -20.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7735 -21.1831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1802 -21.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9974 -21.8941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7697 -22.5985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4041 -22.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1840 -20.4765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2213 -22.6051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6280 -23.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4452 -23.3161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2175 -24.0205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8519 -24.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6691 -24.0271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0796 -23.3205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
7 13 1 0
14 10 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
17 19 1 1
15 20 1 6
16 21 1 6
19 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 2 1 0
2 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
31 36 1 1
35 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
39 41 1 0
41 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.68Molecular Weight (Monoisotopic): 627.2323AlogP: -2.17#Rotatable Bonds: 15Polar Surface Area: 250.34Molecular Species: NEUTRALHBA: 16HBD: 7#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.07CX Basic pKa: 4.92CX LogP: -2.69CX LogD: -2.69Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.08Np Likeness Score: 0.39
References 1. Bellany F,Tsuchiya Y,Tran TM,Chan AWE,Allan H,Gout I,Tabor AB. (2020) Design and synthesis of Coenzyme A analogues as Aurora kinase A inhibitors: An exploration of the roles of the pyrophosphate and pantetheine moieties., 28 (22): [PMID:33007553 ] [10.1016/j.bmc.2020.115740 ]