5-((3-fluoro-4-methoxybenzyl)amino)-2-morpholino-N-neopentylbenzamide

ID: ALA4777417

PubChem CID: 162643040

Max Phase: Preclinical

Molecular Formula: C24H32FN3O3

Molecular Weight: 429.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNc2ccc(N3CCOCC3)c(C(=O)NCC(C)(C)C)c2)cc1F

Standard InChI:  InChI=1S/C24H32FN3O3/c1-24(2,3)16-27-23(29)19-14-18(6-7-21(19)28-9-11-31-12-10-28)26-15-17-5-8-22(30-4)20(25)13-17/h5-8,13-14,26H,9-12,15-16H2,1-4H3,(H,27,29)

Standard InChI Key:  BSXAMZUBINWBJR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   26.0137  -20.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4294  -21.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8316  -20.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4597  -18.5763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3346  -19.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0442  -19.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0414  -18.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3328  -18.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6265  -19.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6278  -18.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9192  -19.8148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2124  -19.4047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9214  -18.1881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.7476  -18.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1634  -18.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8729  -18.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5762  -18.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5688  -17.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8523  -16.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1519  -17.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2732  -16.9216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9771  -17.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6793  -16.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6788  -16.1024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9698  -15.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2614  -16.1067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2876  -18.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2949  -19.3711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9915  -18.1390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0063  -19.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3097  -21.0054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  9  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8 10  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 10 13  1  0
  7 14  1  0
 14  4  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 17 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30  1  1  0
  1 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4777417

    ---

Associated Targets(Human)

ALDH2 Tclin Aldehyde dehydrogenase (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.54Molecular Weight (Monoisotopic): 429.2428AlogP: 4.06#Rotatable Bonds: 7
Polar Surface Area: 62.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.86CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.70Np Likeness Score: -1.86

References

1. Tian W,Guo J,Zhang Q,Fang S,Zhou R,Hu J,Wang M,Zhang Y,Guo JM,Chen Z,Zhu J,Zheng C.  (2021)  The discovery of novel small molecule allosteric activators of aldehyde dehydrogenase 2.,  212  [PMID:33383258] [10.1016/j.ejmech.2020.113119]

Source